EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Br.C17H32NO2 |
| Net Charge | 0 |
| Average Mass | 362.352 |
| Monoisotopic Mass | 361.16164 |
| SMILES | CCCC(CCC)C(=O)OC1CC2CCC(C1)[N+]2(C)C.[Br-] |
| InChI | InChI=1S/C17H32NO2.BrH/c1-5-7-13(8-6-2)17(19)20-16-11-14-9-10-15(12-16)18(14,3)4;/h13-16H,5-12H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | QSFKGMJOKUZAJM-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Roles: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. |
| Applications: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anisotropine methylbromide (CHEBI:2739) has role anti-ulcer drug (CHEBI:49201) |
| anisotropine methylbromide (CHEBI:2739) has role muscarinic antagonist (CHEBI:48876) |
| anisotropine methylbromide (CHEBI:2739) has role parasympatholytic (CHEBI:50370) |
| anisotropine methylbromide (CHEBI:2739) is a organic bromide salt (CHEBI:48369) |
| anisotropine methylbromide (CHEBI:2739) is a quaternary ammonium salt (CHEBI:35273) |
| IUPAC Name |
|---|
| 8,8-dimethyl-3-[(2-propylpentanoyl)oxy]-8-azoniabicyclo[3.2.1]octane bromide |
| INNs | Source |
|---|---|
| méthylbromure d'octatropine | WHO MedNet |
| metilbromuro de octatropina | WHO MedNet |
| octatropine methylbromide | WHO MedNet |
| octatropini methylbromidum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 8-Methyl-3-(2-propylpentanoyloxy)tropinium bromide | ChemIDplus |
| 8-Methyltropinium bromide 2-propylpentanoate | ChemIDplus |
| 8-Methyltropinium bromide 2-propylvalerate | ChemIDplus |
| Anisotropine methobromide | ChemIDplus |
| Anisotropine methylbromide | KEGG COMPOUND |
| endo-8,8-Dimethyl-3-((1-oxo-2-propylpentyl)oxy)-8-azoniabicyclo(3.2.1)octane bromide | ChEBI |