EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:2739 - anisotropine methylbromide
| Formula | Br.C17H32NO2 |
| Net Charge | 0 |
| Average Mass | 362.352 |
| Monoisotopic Mass | 361.16164 |
| SMILES | CCCC(CCC)C(=O)OC1CC2CCC(C1)[N+]2(C)C.[Br-] |
| InChI | InChI=1S/C17H32NO2.BrH/c1-5-7-13(8-6-2)17(19)20-16-11-14-9-10-15(12-16)18(14,3)4;/h13-16H,5-12H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | QSFKGMJOKUZAJM-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Roles: | parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anisotropine methylbromide (CHEBI:2739) has role anti-ulcer drug (CHEBI:49201) |
| anisotropine methylbromide (CHEBI:2739) has role muscarinic antagonist (CHEBI:48876) |
| anisotropine methylbromide (CHEBI:2739) has role parasympatholytic (CHEBI:50370) |
| anisotropine methylbromide (CHEBI:2739) is a organic bromide salt (CHEBI:48369) |
| anisotropine methylbromide (CHEBI:2739) is a quaternary ammonium salt (CHEBI:35273) |
| IUPAC Name |
|---|
| 8,8-dimethyl-3-[(2-propylpentanoyl)oxy]-8-azoniabicyclo[3.2.1]octane bromide |
| INNs | Source |
|---|---|
| méthylbromure d'octatropine | WHO MedNet |
| metilbromuro de octatropina | WHO MedNet |
| octatropine methylbromide | WHO MedNet |
| octatropini methylbromidum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 8-Methyl-3-(2-propylpentanoyloxy)tropinium bromide | ChemIDplus |
| 8-Methyltropinium bromide 2-propylpentanoate | ChemIDplus |
| 8-Methyltropinium bromide 2-propylvalerate | ChemIDplus |
| Anisotropine methobromide | ChemIDplus |
| Anisotropine methylbromide | KEGG COMPOUND |
| endo-8,8-Dimethyl-3-((1-oxo-2-propylpentyl)oxy)-8-azoniabicyclo(3.2.1)octane bromide | ChEBI |