EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H19NO4 |
| Net Charge | 0 |
| Average Mass | 205.254 |
| Monoisotopic Mass | 205.13141 |
| SMILES | CC(C)(CO)[C@@H](O)C(=O)NCCCO |
| InChI | InChI=1S/C9H19NO4/c1-9(2,6-12)7(13)8(14)10-4-3-5-11/h7,11-13H,3-6H2,1-2H3,(H,10,14)/t7-/m0/s1 |
| InChIKey | SNPLKNRPJHDVJA-ZETCQYMHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | provitamin A substance that can be converted into a vitamin by animal tissues. cholinergic drug Any drug used for its actions on cholinergic systems. Included here are agonists and antagonists, drugs that affect the life cycle of acetylcholine, and drugs that affect the survival of cholinergic neurons. |
| Application: | cholinergic drug Any drug used for its actions on cholinergic systems. Included here are agonists and antagonists, drugs that affect the life cycle of acetylcholine, and drugs that affect the survival of cholinergic neurons. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pantothenol (CHEBI:27373) has role cholinergic drug (CHEBI:38323) |
| pantothenol (CHEBI:27373) has role provitamin (CHEBI:50188) |
| pantothenol (CHEBI:27373) is a amino alcohol (CHEBI:22478) |
| pantothenol (CHEBI:27373) is a monocarboxylic acid amide (CHEBI:29347) |
| IUPAC Name |
|---|
| (2R)-2,4-dihydroxy-N-(3-hydroxypropyl)-3,3-dimethylbutanamide |
| INN | Source |
|---|---|
| dexpanthenol | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2,4-Dihydroxy-N-(3-hydroxypropyl)-3,3-dimethylbutanamide | KEGG COMPOUND |
| Bepanthen | KEGG COMPOUND |
| Bepanthene | KEGG COMPOUND |
| Bepantol | KEGG COMPOUND |
| Cozyme | KEGG COMPOUND |
| D-(+)-2,4-Dihydroxy-N-(3-hydroxypropyl)-3,3-dimethylbutyramide | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Ilopan | KEGG DRUG |
| Citations |
|---|