EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:27373 - pantothenol
| Formula | C9H19NO4 |
| Net Charge | 0 |
| Average Mass | 205.254 |
| Monoisotopic Mass | 205.13141 |
| SMILES | CC(C)(CO)[C@@H](O)C(=O)NCCCO |
| InChI | InChI=1S/C9H19NO4/c1-9(2,6-12)7(13)8(14)10-4-3-5-11/h7,11-13H,3-6H2,1-2H3,(H,10,14)/t7-/m0/s1 |
| InChIKey | SNPLKNRPJHDVJA-ZETCQYMHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | provitamin A substance that can be converted into a vitamin by animal tissues. cholinergic drug Any drug used for its actions on cholinergic systems. Included here are agonists and antagonists, drugs that affect the life cycle of acetylcholine, and drugs that affect the survival of cholinergic neurons. |
| Applications: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. anti-inflammatory agent Any compound that has anti-inflammatory effects. cholinergic drug Any drug used for its actions on cholinergic systems. Included here are agonists and antagonists, drugs that affect the life cycle of acetylcholine, and drugs that affect the survival of cholinergic neurons. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pantothenol (CHEBI:27373) has role anti-inflammatory agent (CHEBI:67079) |
| pantothenol (CHEBI:27373) has role anti-ulcer drug (CHEBI:49201) |
| pantothenol (CHEBI:27373) has role cholinergic drug (CHEBI:38323) |
| pantothenol (CHEBI:27373) has role ophthalmology drug (CHEBI:66981) |
| pantothenol (CHEBI:27373) has role provitamin (CHEBI:50188) |
| pantothenol (CHEBI:27373) is a amino alcohol (CHEBI:22478) |
| pantothenol (CHEBI:27373) is a monocarboxylic acid amide (CHEBI:29347) |
| IUPAC Name |
|---|
| (2R)-2,4-dihydroxy-N-(3-hydroxypropyl)-3,3-dimethylbutanamide |
| INN | Source |
|---|---|
| dexpanthenol | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2,4-Dihydroxy-N-(3-hydroxypropyl)-3,3-dimethylbutanamide | KEGG COMPOUND |
| Bepanthen | KEGG COMPOUND |
| Bepanthene | KEGG COMPOUND |
| Bepantol | KEGG COMPOUND |
| Cozyme | KEGG COMPOUND |
| D-(+)-2,4-Dihydroxy-N-(3-hydroxypropyl)-3,3-dimethylbutyramide | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Ilopan | KEGG DRUG |
| Citations |
|---|