EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12O5 |
| Net Charge | 0 |
| Average Mass | 152.146 |
| Monoisotopic Mass | 152.06847 |
| SMILES | OC[C@@H](O)[C@H](O)[C@@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[h212h]/1/ |
| InChI | InChI=1S/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4+,5+ |
| InChIKey | HEBKCHPVOIAQTA-SCDXWVJYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Chemical Role: | sweetening agent Substance that sweeten food, beverages, medications, etc. |
| Biological Roles: | sweetening agent Substance that sweeten food, beverages, medications, etc. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Applications: | sweetening agent Substance that sweeten food, beverages, medications, etc. hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xylitol (CHEBI:17151) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| xylitol (CHEBI:17151) has role algal metabolite (CHEBI:84735) |
| xylitol (CHEBI:17151) has role allergen (CHEBI:50904) |
| xylitol (CHEBI:17151) has role antibacterial agent (CHEBI:33282) |
| xylitol (CHEBI:17151) has role hapten (CHEBI:59174) |
| xylitol (CHEBI:17151) has role human metabolite (CHEBI:77746) |
| xylitol (CHEBI:17151) has role hypoglycemic agent (CHEBI:35526) |
| xylitol (CHEBI:17151) has role mouse metabolite (CHEBI:75771) |
| xylitol (CHEBI:17151) has role sweetening agent (CHEBI:50505) |
| xylitol (CHEBI:17151) is a pentitol (CHEBI:25899) |
| Incoming Relation(s) |
| xylitol 5-phosphate (CHEBI:16772) has functional parent xylitol (CHEBI:17151) |
| xylitol 5-phosphate(2−) (CHEBI:370252) has functional parent xylitol (CHEBI:17151) |
| IUPAC Names |
|---|
| (2R,3r,4S)-pentane-1,2,3,4,5-pentol |
| meso-xylitol |
| Synonyms | Source |
|---|---|
| (2R,3R,4S)-Pentane-1,2,3,4,5-pentaol | ChEMBL |
| C-xylidex cr 16055 | ChEMBL |
| D-XYLITOL | PDBeChem |
| E-967 | ChEMBL |
| E967 | ChEMBL |
| INS-967 | ChEMBL |
| Brand Name | Source |
|---|---|
| Torch | ChEMBL |
| UniProt Name | Source |
|---|---|
| xylitol | UniProt |
| Citations |
|---|