EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12O5 |
| Net Charge | 0 |
| Average Mass | 152.146 |
| Monoisotopic Mass | 152.06847 |
| SMILES | OC[C@@H](O)[C@H](O)[C@@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[h212h]/1/ |
| InChI | InChI=1S/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4+,5+ |
| InChIKey | HEBKCHPVOIAQTA-SCDXWVJYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Chemical Role: | sweetening agent Substance that sweeten food, beverages, medications, etc. |
| Biological Roles: | sweetening agent Substance that sweeten food, beverages, medications, etc. hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| Application: | sweetening agent Substance that sweeten food, beverages, medications, etc. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xylitol (CHEBI:17151) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| xylitol (CHEBI:17151) has role algal metabolite (CHEBI:84735) |
| xylitol (CHEBI:17151) has role allergen (CHEBI:50904) |
| xylitol (CHEBI:17151) has role hapten (CHEBI:59174) |
| xylitol (CHEBI:17151) has role human metabolite (CHEBI:77746) |
| xylitol (CHEBI:17151) has role mouse metabolite (CHEBI:75771) |
| xylitol (CHEBI:17151) has role sweetening agent (CHEBI:50505) |
| xylitol (CHEBI:17151) is a pentitol (CHEBI:25899) |
| Incoming Relation(s) |
| xylitol 5-phosphate (CHEBI:16772) has functional parent xylitol (CHEBI:17151) |
| xylitol 5-phosphate(2−) (CHEBI:370252) has functional parent xylitol (CHEBI:17151) |
| IUPAC Names |
|---|
| (2R,3r,4S)-pentane-1,2,3,4,5-pentol |
| meso-xylitol |
| Synonyms | Source |
|---|---|
| (2R,3R,4S)-Pentane-1,2,3,4,5-pentaol | ChEMBL |
| D-XYLITOL | PDBeChem |
| L-xylitol | ChEBI |
| Xylit | ChEBI |
| xylite | NIST Chemistry WebBook |
| Xylitol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| xylitol | UniProt |
| Citations |
|---|