EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N2O9P |
| Net Charge | 0 |
| Average Mass | 324.182 |
| Monoisotopic Mass | 324.03587 |
| SMILES | O=c1ccn([C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C9H13N2O9P/c12-5-1-2-11(9(15)10-5)8-7(14)6(13)4(20-8)3-19-21(16,17)18/h1-2,4,6-8,13-14H,3H2,(H,10,12,15)(H2,16,17,18)/t4-,6-,7-,8-/m1/s1 |
| InChIKey | DJJCXFVJDGTHFX-XVFCMESISA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| uridine 5'-monophosphate (CHEBI:16695) has role Escherichia coli metabolite (CHEBI:76971) |
| uridine 5'-monophosphate (CHEBI:16695) has role human metabolite (CHEBI:77746) |
| uridine 5'-monophosphate (CHEBI:16695) has role mouse metabolite (CHEBI:75771) |
| uridine 5'-monophosphate (CHEBI:16695) is a pyrimidine ribonucleoside 5'-monophosphate (CHEBI:39457) |
| uridine 5'-monophosphate (CHEBI:16695) is a uridine 5'-phosphate (CHEBI:27232) |
| uridine 5'-monophosphate (CHEBI:16695) is conjugate acid of uridine 5'-monophosphate(2−) (CHEBI:57865) |
| Incoming Relation(s) |
| N3-methyluridine 5'-monophosphate (CHEBI:74773) has functional parent uridine 5'-monophosphate (CHEBI:16695) |
| O4'-(5'-uridylyl)-L-tyrosine (CHEBI:21989) has functional parent uridine 5'-monophosphate (CHEBI:16695) |
| 2'-O-methyluridine 5'-monophosphate (CHEBI:44642) has functional parent uridine 5'-monophosphate (CHEBI:16695) |
| 5-(2-methoxy-2-oxoethyl)uridine 5'-monophosphate (CHEBI:75650) has functional parent uridine 5'-monophosphate (CHEBI:16695) |
| 5-aminomethyl-2-thiouridine 5'-monophosphate (CHEBI:74678) has functional parent uridine 5'-monophosphate (CHEBI:16695) |
| 5-bromouridine 5'-monophosphate (CHEBI:47131) has functional parent uridine 5'-monophosphate (CHEBI:16695) |
| 5-carboxymethylaminomethyl-2'-O-methyluridine 5'-monophosphate (CHEBI:74785) has functional parent uridine 5'-monophosphate (CHEBI:16695) |
| 5-carboxymethylaminomethyluridine 5'-monophosphate (CHEBI:74782) has functional parent uridine 5'-monophosphate (CHEBI:16695) |
| 5-fluorouridine 5'-monophosphate (CHEBI:40101) has functional parent uridine 5'-monophosphate (CHEBI:16695) |
| 5-methylaminomethyl-2-thiouridine 5'-monophosphate (CHEBI:74680) has functional parent uridine 5'-monophosphate (CHEBI:16695) |
| 5,6-dihydrouridine 5'-monophosphate (CHEBI:74673) has functional parent uridine 5'-monophosphate (CHEBI:16695) |
| 6-oxouridine 5'-phosphate (CHEBI:41150) has functional parent uridine 5'-monophosphate (CHEBI:16695) |
| ddhUMP (CHEBI:156340) has functional parent uridine 5'-monophosphate (CHEBI:16695) |
| sofosbuvir (CHEBI:85083) has functional parent uridine 5'-monophosphate (CHEBI:16695) |
| uracil octosyl acid 5'-phosphate (CHEBI:133866) has functional parent uridine 5'-monophosphate (CHEBI:16695) |
| uridine 5'-monophosphate(2−) (CHEBI:57865) is conjugate base of uridine 5'-monophosphate (CHEBI:16695) |
| UMP 3'-end residue (CHEBI:53120) is substituent group from uridine 5'-monophosphate (CHEBI:16695) |
| UMP 5'-end residue (CHEBI:53105) is substituent group from uridine 5'-monophosphate (CHEBI:16695) |
| uridine 5'-monophosphate residue (CHEBI:46470) is substituent group from uridine 5'-monophosphate (CHEBI:16695) |
| IUPAC Name |
|---|
| 5'-uridylic acid |
| Synonyms | Source |
|---|---|
| 5'-UMP | ChemIDplus |
| 5'Uridylic acid | KEGG COMPOUND |
| pU | ChEBI |
| pU | IUBMB |
| UMP | KEGG COMPOUND |
| uridine 5'-(dihydrogen phosphate) | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00007311 | KNApSAcK |
| C00105 | KEGG COMPOUND |
| DB03685 | DrugBank |
| HMDB0000288 | HMDB |
| U5PrF10 | PDBeChem |
| UMP | MetaCyc |
| UrF10 | PDBeChem |
| Uridine_monophosphate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Gmelin:310455 | Gmelin |
| Reaxys:47486 | Reaxys |
| CAS:58-97-9 | ChemIDplus |
| CAS:58-97-9 | KEGG COMPOUND |
| Citations |
|---|