EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H21NO5 |
| Net Charge | 0 |
| Average Mass | 379.412 |
| Monoisotopic Mass | 379.14197 |
| SMILES | COc1ccc2c(c1OC)C(OC)N(C)c1c-2ccc2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C22H21NO5/c1-23-20-14(6-5-12-9-17-18(10-15(12)20)28-11-27-17)13-7-8-16(24-2)21(25-3)19(13)22(23)26-4/h5-10,22H,11H2,1-4H3 |
| InChIKey | LVWAKZBZWYHYCJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Angoline (CHEBI:2721) is a benzophenanthridine alkaloid (CHEBI:38517) |
| Synonym | Source |
|---|---|
| Angoline | KEGG COMPOUND |