EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C62H89N17O14 |
| Net Charge | 0 |
| Average Mass | 1296.499 |
| Monoisotopic Mass | 1295.67749 |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](N)CC(=O)O)C(C)C)C(=O)N[C@@H](Cc1cncn1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1cncn1)C(=O)N[C@@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C62H89N17O14/c1-7-35(6)51(78-56(87)44(25-37-17-19-40(80)20-18-37)74-58(89)50(34(4)5)77-53(84)42(15-11-21-68-62(64)65)71-52(83)41(63)28-49(81)82)59(90)75-46(27-39-30-67-32-70-39)60(91)79-22-12-16-48(79)57(88)73-43(24-36-13-9-8-10-14-36)54(85)72-45(26-38-29-66-31-69-38)55(86)76-47(61(92)93)23-33(2)3/h8-10,13-14,17-20,29-35,41-48,50-51,80H,7,11-12,15-16,21-28,63H2,1-6H3,(H,66,69)(H,67,70)(H,71,83)(H,72,85)(H,73,88)(H,74,89)(H,75,90)(H,76,86)(H,77,84)(H,78,87)(H,81,82)(H,92,93)(H4,64,65,68)/t35-,41-,42-,43-,44-,45-,46-,47-,48-,50-,51-/m0/s1 |
| InChIKey | ORWYRWWVDCYOMK-HBZPZAIKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO_0000131) | PubMed (8142230) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | neurotransmitter agent A substance used for its pharmacological action on any aspect of neurotransmitter systems. Neurotransmitter agents include agonists, antagonists, degradation inhibitors, uptake inhibitors, depleters, precursors, and modulators of receptor function. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Application: | neurotransmitter agent A substance used for its pharmacological action on any aspect of neurotransmitter systems. Neurotransmitter agents include agonists, antagonists, degradation inhibitors, uptake inhibitors, depleters, precursors, and modulators of receptor function. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| angiotensin I (CHEBI:2718) has role human metabolite (CHEBI:77746) |
| angiotensin I (CHEBI:2718) has role neurotransmitter agent (CHEBI:35942) |
| angiotensin I (CHEBI:2718) is a angiotensin (CHEBI:48433) |
| angiotensin I (CHEBI:2718) is tautomer of angiotensin I dizwitterion (CHEBI:147350) |
| Incoming Relation(s) |
| angiotensin I dizwitterion (CHEBI:147350) is tautomer of angiotensin I (CHEBI:2718) |
| IUPAC Name |
|---|
| L-α-aspartyl-L-arginyl-L-valyl-L-tyrosyl-L-isoleucyl-L-histidyl-L-prolyl-L-phenylalanyl-L-histidyl-L-leucine |
| Synonyms | Source |
|---|---|
| angiotensin I | KEGG COMPOUND |
| Asp-Arg-Val-Tyr-Ile-His-Pro-Phe-His-Leu | MetaCyc |
| D-R-V-Y-I-H-P-F-H-L | ChEBI |
| DRVYIHPFHL | ChEBI |
| pepsitensin | ChemIDplus |
| proangiotensin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00873 | KEGG COMPOUND |
| CPD-13004 | MetaCyc |
| HMDB0061196 | HMDB |
| WO2009040072 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:9041-90-1 | ChemIDplus |
| Citations |
|---|