EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30O2 |
| Net Charge | 0 |
| Average Mass | 290.447 |
| Monoisotopic Mass | 290.22458 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@@H](O)CC[C@@]21[H] |
| InChI | InChI=1S/C19H30O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h3,13-17,20-21H,4-11H2,1-2H3/t13-,14-,15-,16-,17-,18-,19-/m0/s1 |
| InChIKey | QADHLRWLCPCEKT-LOVVWNRFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Application: | radiation protective agent Any compound that is able to protect normal cells from the damage caused by radiation therapy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| androst-5-ene-3β,17β-diol (CHEBI:2710) has parent hydride androstane (CHEBI:35509) |
| androst-5-ene-3β,17β-diol (CHEBI:2710) has role androgen (CHEBI:50113) |
| androst-5-ene-3β,17β-diol (CHEBI:2710) has role human metabolite (CHEBI:77746) |
| androst-5-ene-3β,17β-diol (CHEBI:2710) has role mouse metabolite (CHEBI:75771) |
| androst-5-ene-3β,17β-diol (CHEBI:2710) has role radiation protective agent (CHEBI:66987) |
| androst-5-ene-3β,17β-diol (CHEBI:2710) is a 17β-hydroxy steroid (CHEBI:35343) |
| androst-5-ene-3β,17β-diol (CHEBI:2710) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| Incoming Relation(s) |
| androstenediol 3-sulfate(1−) (CHEBI:190287) has functional parent androst-5-ene-3β,17β-diol (CHEBI:2710) |
| IUPAC Name |
|---|
| androst-5-ene-3β,17β-diol |
| Synonyms | Source |
|---|---|
| 3beta,17beta-Dihydroxy-5-androstene | KEGG COMPOUND |
| 3beta,17beta-Dihydroxyandrost-5-ene | KEGG COMPOUND |
| (3β,17β)-androst-5-ene-3,17-diol | ChemIDplus |
| 3β,17β-dihydroxyandrost-5-ene | ChemIDplus |
| 5-androstenediol | ChEBI |
| Androst-5-ene-3beta,17beta-diol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| androst-5-en-3β,17β-diol | UniProt |
| Citations |
|---|