EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O3 |
| Net Charge | 0 |
| Average Mass | 250.338 |
| Monoisotopic Mass | 250.15689 |
| SMILES | CC1=CC(=O)CC(C)(C)[C@@]1(O)/C=C/C(C)=C/CO |
| InChI | InChI=1S/C15H22O3/c1-11(6-8-16)5-7-15(18)12(2)9-13(17)10-14(15,3)4/h5-7,9,16,18H,8,10H2,1-4H3/b7-5+,11-6+/t15-/m1/s1 |
| InChIKey | GRJFTUSJGMRSSJ-SQGBXOFWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Averrhoa carambola (ncbitaxon:28974) | fruit (BTO:0000486) | DOI (10.1016/S0031-9422(00)89824-6) | |
| Chenopodium album (ncbitaxon:3559) | - | PubMed (15387648) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-abscisic alcohol (CHEBI:27068) has role plant metabolite (CHEBI:76924) |
| trans-abscisic alcohol (CHEBI:27068) is a abscisic alcohol (CHEBI:22145) |
| IUPAC Name |
|---|
| (4S)-4-hydroxy-4-[(1E,3E)-5-hydroxy-3-methylpenta-1,3-dien-1-yl]-3,5,5-trimethylcyclohex-2-en-1-one |
| Synonyms | Source |
|---|---|
| (4S)-4-Hydroxy-4-[(1E,3E)-5-hydroxy-3-methyl-1,3-pentadien-1-yl]-3,5,5-trimethyl-2-cyclohexen-1-one | CAS |
| trans-ABA-alcohol | ChEBI |
| trans-abscisic acid alcohol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD4FS-8 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| CAS:113472-20-1 | CAS |
| Citations |
|---|