EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO3 |
| Net Charge | 0 |
| Average Mass | 131.131 |
| Monoisotopic Mass | 131.05824 |
| SMILES | O=C(O)[C@H]1NCC[C@@H]1O |
| InChI | InChI=1S/C5H9NO3/c7-3-1-2-6-4(3)5(8)9/h3-4,6-7H,1-2H2,(H,8,9)/t3-,4-/m0/s1 |
| InChIKey | BJBUEDPLEOHJGE-IMJSIDKUSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-3-hydroxy-L-proline (CHEBI:16889) has role metabolite (CHEBI:25212) |
| trans-3-hydroxy-L-proline (CHEBI:16889) is a 3-hydroxy-L-proline (CHEBI:20056) |
| trans-3-hydroxy-L-proline (CHEBI:16889) is tautomer of trans-3-hydroxy-L-proline zwitterion (CHEBI:57938) |
| Incoming Relation(s) |
| trans-3-hydroxy-L-proline residue (CHEBI:85428) is substituent group from trans-3-hydroxy-L-proline (CHEBI:16889) |
| trans-3-hydroxy-L-proline zwitterion (CHEBI:57938) is tautomer of trans-3-hydroxy-L-proline (CHEBI:16889) |
| IUPAC Name |
|---|
| (3S)-3-hydroxy-L-proline |
| Synonyms | Source |
|---|---|
| (2S,3S)-3-hydroxypyrrolidine-2-carboxylic acid | ChEBI |
| 3-trans-hydroxy-L-proline | ChEBI |
| L-threo-3-hydroxyproline | ChEBI |
| trans-3-hydroxy-L-proline | ChEBI |
| trans-L-3-hydroxyproline | ChEBI |
| trans-L-3-Hydroxyproline | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C05147 | KEGG COMPOUND |
| CPD-664 | MetaCyc |
| HMDB0059659 | HMDB |
| HY3 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:471959 | Reaxys |
| Citations |
|---|