EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O2 |
| Net Charge | 0 |
| Average Mass | 168.236 |
| Monoisotopic Mass | 168.11503 |
| SMILES | C=C(C/C=C(\C)C(=O)O)C(C)C |
| InChI | InChI=1S/C10H16O2/c1-7(2)8(3)5-6-9(4)10(11)12/h6-7H,3,5H2,1-2,4H3,(H,11,12)/b9-6+ |
| InChIKey | HZNKOKJSWBRPRJ-RMKNXTFCSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-2,6-dimethyl-5-methylenehept-2-enoic acid (CHEBI:27050) is a 2,6-dimethyl-5-methylenehept-2-enoic acid (CHEBI:36153) |
| Incoming Relation(s) |
| trans-2-methyl-5-isopropylhexa-2,5-dienoyl-CoA (CHEBI:29742) has functional parent trans-2,6-dimethyl-5-methylenehept-2-enoic acid (CHEBI:27050) |
| IUPAC Name |
|---|
| (2E)-2,6-dimethyl-5-methylenehept-2-enoic acid |
| Synonym | Source |
|---|---|
| trans-2-Methyl-5-isopropylhexa-2,5-dienoic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C11943 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:65860-54-0 | KEGG COMPOUND |