EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19N5 |
| Net Charge | 0 |
| Average Mass | 293.374 |
| Monoisotopic Mass | 293.16405 |
| SMILES | CC(C)(C#N)c1cc(Cn2cncn2)cc(C(C)(C)C#N)c1 |
| InChI | InChI=1S/C17H19N5/c1-16(2,9-18)14-5-13(8-22-12-20-11-21-22)6-15(7-14)17(3,4)10-19/h5-7,11-12H,8H2,1-4H3 |
| InChIKey | YBBLVLTVTVSKRW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 1.14.14.14 (aromatase) inhibitor An EC 1.14.14.* (oxidoreductase acting on paired donors, incorporating of 1 atom of oxygen, with reduced flavin or flavoprotein as one donor) inhibitor which interferes with the action of aromatase (EC 1.14.14.14) and so reduces production of estrogenic steroid hormones. |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anastrozole (CHEBI:2704) has role antihypertensive agent (CHEBI:35674) |
| anastrozole (CHEBI:2704) has role antineoplastic agent (CHEBI:35610) |
| anastrozole (CHEBI:2704) has role EC 1.14.14.14 (aromatase) inhibitor (CHEBI:50790) |
| anastrozole (CHEBI:2704) has role geroprotector (CHEBI:176497) |
| anastrozole (CHEBI:2704) is a nitrile (CHEBI:18379) |
| anastrozole (CHEBI:2704) is a triazoles (CHEBI:35727) |
| Incoming Relation(s) |
| 1-{[3,5-bis(1-cyano-1-methylethyl)phenyl]methyl}-4-[(3S,4R,5R,6R)-6-carboxy-3,4,5-trihydroxyoxan-2-yl]-1,2,4lambda5-triazol-4-ylium (CHEBI:143328) has functional parent anastrozole (CHEBI:2704) |
| IUPAC Name |
|---|
| 2,2'-[5-(1H-1,2,4-triazol-1-ylmethyl)-1,3-phenylene]bis(2-methylpropanenitrile) |
| INN | Source |
|---|---|
| anastrozole | KEGG DRUG |
| Synonyms | Source |
|---|---|
| Anastrozol | DrugBank |
| ICI D1033 | ChEMBL |
| ICI-D1033 | ChEMBL |
| NSC-719344 | ChEMBL |
| NSC-759855 | ChEMBL |
| Rvg-106400 | ChEMBL |
| Brand Name | Source |
|---|---|
| Nastrosa | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8005958 | Beilstein |
| CAS:120511-73-1 | ChemIDplus |
| CAS:120511-73-1 | KEGG COMPOUND |
| CAS:120511-73-1 | KEGG DRUG |
| CAS:120511-73-1 | DrugBank |
| Citations |
|---|