EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:27999 - tolbutamide
| Formula | C12H18N2O3S |
| Net Charge | 0 |
| Average Mass | 270.354 |
| Monoisotopic Mass | 270.10381 |
| SMILES | CCCCNC(=O)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C12H18N2O3S/c1-3-4-9-13-12(15)14-18(16,17)11-7-5-10(2)6-8-11/h5-8H,3-4,9H2,1-2H3,(H2,13,14,15) |
| InChIKey | JLRGJRBPOGGCBT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Roles: | insulin secretagogue A secretagogue that causes the secretion of insulin. potassium channel blocker An agent that inhibits cell membrane glycoproteins that are selectively permeable to potassium ions. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tolbutamide (CHEBI:27999) has role human metabolite (CHEBI:77746) |
| tolbutamide (CHEBI:27999) has role hypoglycemic agent (CHEBI:35526) |
| tolbutamide (CHEBI:27999) has role insulin secretagogue (CHEBI:90415) |
| tolbutamide (CHEBI:27999) has role potassium channel blocker (CHEBI:50509) |
| tolbutamide (CHEBI:27999) is a N-sulfonylurea (CHEBI:76983) |
| IUPAC Name |
|---|
| N-[(butylamino)carbonyl]-4-methylbenzenesulfonamide |
| INNs | Source |
|---|---|
| tolbutamida | ChemIDplus |
| tolbutamide | ChemIDplus |
| tolbutamidum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-Butyl-3-(p-methylphenylsulfonyl)urea | ChemIDplus |
| 1-Butyl-3-(p-tolylsulfonyl)urea | ChemIDplus |
| 1-Butyl-3-tosylurea | ChemIDplus |
| 1-p-Toluenesulfonyl-3-butylurea | ChemIDplus |
| 3-(p-Tolyl-4-sulfonyl)-1-butylurea | ChemIDplus |
| N-(4-Methylbenzenesulfonyl)-N'-butylurea | ChemIDplus |
| Citations |
|---|