EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H38O2 |
| Net Charge | 0 |
| Average Mass | 382.588 |
| Monoisotopic Mass | 382.28718 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC[C@]1(C)CCc2cc(O)ccc2O1 |
| InChI | InChI=1S/C26H38O2/c1-20(2)9-6-10-21(3)11-7-12-22(4)13-8-17-26(5)18-16-23-19-24(27)14-15-25(23)28-26/h9,11,13-15,19,27H,6-8,10,12,16-18H2,1-5H3/b21-11+,22-13+/t26-/m1/s1 |
| InChIKey | GJJVAFUKOBZPCB-HQLRYZJNSA-N |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| desmethyl tocotrienol (CHEBI:27017) has role plant metabolite (CHEBI:76924) |
| desmethyl tocotrienol (CHEBI:27017) is a tocotrienol (CHEBI:33235) |
| IUPAC Name |
|---|
| (2R)-2-methyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trien-1-yl]-3,4-dihydro-2H-chromen-6-ol |
| Synonym | Source |
|---|---|
| 3,4-dihydro-2-methyl-2-(4,8,12-trimethyltrideca-3'(E),7'(E),11'-trienyl)-2H-1-benzopyran-6-ol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8729806 | Reaxys |
| Citations |
|---|