EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16 |
| Net Charge | 0 |
| Average Mass | 136.238 |
| Monoisotopic Mass | 136.12520 |
| SMILES | [H][C@]1(C(=C)C)CC=C(C)CC1 |
| InChI | InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,10H,1,5-7H2,2-3H3/t10-/m0/s1 |
| InChIKey | XMGQYMWWDOXHJM-JTQLQIEISA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4R)-limonene (CHEBI:15382) has role plant metabolite (CHEBI:76924) |
| (4R)-limonene (CHEBI:15382) is a limonene (CHEBI:15384) |
| (4R)-limonene (CHEBI:15382) is enantiomer of (4S)-limonene (CHEBI:15383) |
| Incoming Relation(s) |
| (4R)-limonene 1,2-epoxide (CHEBI:35672) has parent hydride (4R)-limonene (CHEBI:15382) |
| (4R)-limonene hydroperoxide (CHEBI:134497) has parent hydride (4R)-limonene (CHEBI:15382) |
| (5R)-5-isopropenyl-2-methylcyclohexane 1-hydroperoxide (CHEBI:59623) has parent hydride (4R)-limonene (CHEBI:15382) |
| (4S)-limonene (CHEBI:15383) is enantiomer of (4R)-limonene (CHEBI:15382) |
| IUPAC Name |
|---|
| (4R)-1-methyl-4-(prop-1-en-2-yl)cyclohex-1-ene |
| Synonyms | Source |
|---|---|
| (4R)-1-methyl-4-isopropenylcyclohex-1-ene | IUBMB |
| (4R)-4-isopropenyl-1-methylcyclohexene | ChEBI |
| (+)-4-isopropenyl-1-methylcyclohexene | ChemIDplus |
| (+)-(4R)-Limonene | KEGG COMPOUND |
| 4βH-p-mentha-1,8-diene | IUPAC |
| d-limonene | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (4R)-limonene | UniProt |
| Citations |
|---|