EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11NO2 |
| Net Charge | 0 |
| Average Mass | 117.148 |
| Monoisotopic Mass | 117.07898 |
| SMILES | CC(C)CCON=O |
| InChI | InChI=1S/C5H11NO2/c1-5(2)3-4-8-6-7/h5H,3-4H2,1-2H3 |
| InChIKey | OWFXIOWLTKNBAP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoamyl nitrite (CHEBI:2691) has functional parent isoamylol (CHEBI:15837) |
| isoamyl nitrite (CHEBI:2691) has role antihypertensive agent (CHEBI:35674) |
| isoamyl nitrite (CHEBI:2691) has role vasodilator agent (CHEBI:35620) |
| isoamyl nitrite (CHEBI:2691) is a nitrite esters (CHEBI:46649) |
| IUPAC Name |
|---|
| 3-methylbutyl nitrite |
| Synonyms | Source |
|---|---|
| 3-methylbutanol nitrite | NIST Chemistry WebBook |
| 3-Methylbutyl nitrite | DrugBank |
| Amilnitrite | DrugBank |
| Amyl nitrite I | DrugBank |
| Amyl nitrosum | DrugBank |
| IPN | DrugBank |