EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H19N3O3S |
| Net Charge | 0 |
| Average Mass | 393.468 |
| Monoisotopic Mass | 393.11471 |
| SMILES | COc1cc(NS(C)(=O)=O)ccc1Nc1c2ccccc2nc2ccccc12 |
| InChI | InChI=1S/C21H19N3O3S/c1-27-20-13-14(24-28(2,25)26)11-12-19(20)23-21-15-7-3-5-9-17(15)22-18-10-6-4-8-16(18)21/h3-13,24H,1-2H3,(H,22,23) |
| InChIKey | XCPGHVQEEXUHNC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase (ATP-hydrolysing), EC 5.99.1.3 (also known as topoisomerase II and as DNA gyrase), which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amsacrine (CHEBI:2687) has role antineoplastic agent (CHEBI:35610) |
| amsacrine (CHEBI:2687) has role EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor (CHEBI:50750) |
| amsacrine (CHEBI:2687) is a acridines (CHEBI:22213) |
| amsacrine (CHEBI:2687) is a aromatic ether (CHEBI:35618) |
| amsacrine (CHEBI:2687) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| N-[4-(acridin-9-ylamino)-3-methoxyphenyl]methanesulfonamide |
| INNs | Source |
|---|---|
| amsacrina | ChemIDplus |
| amsacrinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4'-(9-Acridinylamino)-3'-methoxymethanesulfonanilide | KEGG COMPOUND |
| 4'-(9-Acridinylamino)methanesulfon-m-anisidide | ChemIDplus |
| 4'-(9-Acridinylamino)methanesulfon-meta-anisidide | ChemIDplus |
| 4'-(9-Acridinylamino)methanesulphon-m-anisidide | ChemIDplus |
| Amsacrine | KEGG COMPOUND |
| CI-880 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:500176 | Reaxys |
| CAS:51264-14-3 | ChemIDplus |
| CAS:51264-14-3 | KEGG COMPOUND |
| Citations |
|---|