EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H9N3O |
| Net Charge | 0 |
| Average Mass | 187.202 |
| Monoisotopic Mass | 187.07456 |
| SMILES | Nc1cc(-c2ccncc2)cnc1=O |
| InChI | InChI=1S/C10H9N3O/c11-9-5-8(6-13-10(9)14)7-1-3-12-4-2-7/h1-6H,11H2,(H,13,14) |
| InChIKey | RNLQIBCLLYYYFJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 3.1.4.* (phosphoric diester hydrolase) inhibitor An EC 3.1.* (ester hydrolase) inhibitor that interferes with the action of a phosphoric diester hydrolase (EC 3.1.4.*). |
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amrinone (CHEBI:2686) has role cardiovascular drug (CHEBI:35554) |
| amrinone (CHEBI:2686) has role EC 3.1.4.* (phosphoric diester hydrolase) inhibitor (CHEBI:50218) |
| amrinone (CHEBI:2686) is a bipyridines (CHEBI:50511) |
| IUPAC Name |
|---|
| 5-amino[3,4'-bipyridin]-6(1H)-one |
| INNs | Source |
|---|---|
| amrinone | WHO MedNet |
| amrinona | WHO MedNet |
| amrinone | WHO MedNet |
| amrinonum | WHO MedNet |
| Synonyms | Source |
|---|---|
| inamrinone | KEGG DRUG |
| WIN-40680 | DrugBank |
| WIN 40680 | DrugBank |
| 5-amino-1,6-dihydro-6-oxo-[3,4'-bipyridine] | ChEBI |
| 3-amino-5-(4-pyridinyl)-1,2-dihydro-2-pyridone | ChEBI |
| 3-amino-5-pyridin-4-yl-1H-pyridin-2-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:60719-84-8 | DrugCentral |
| CAS:60719-84-8 | ChemIDplus |
| Citations |
|---|