EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10O2 |
| Net Charge | 0 |
| Average Mass | 138.166 |
| Monoisotopic Mass | 138.06808 |
| SMILES | C=CC1=CC=C[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C8H10O2/c1-2-6-4-3-5-7(9)8(6)10/h2-5,7-10H,1H2/t7-,8+/m1/s1 |
| InChIKey | VQKKVCTZENPFCZ-SFYZADRCSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1R,2S)-3-ethenylcyclohexa-3,5-diene-1,2-diol (CHEBI:26797) is a cis-3-ethenylcyclohexa-3,5-diene-1,2-diol (CHEBI:28980) |
| (1R,2S)-3-ethenylcyclohexa-3,5-diene-1,2-diol (CHEBI:26797) is enantiomer of (1S,2R)-3-ethenylcyclohexa-3,5-diene-1,2-diol (CHEBI:51008) |
| Incoming Relation(s) |
| (1S,2R)-3-ethenylcyclohexa-3,5-diene-1,2-diol (CHEBI:51008) is enantiomer of (1R,2S)-3-ethenylcyclohexa-3,5-diene-1,2-diol (CHEBI:26797) |
| IUPAC Name |
|---|
| (1R,2S)-3-ethenylcyclohexa-3,5-diene-1,2-diol |
| Synonym | Source |
|---|---|
| styrene cis-glycol | UM-BBD |
| Manual Xrefs | Databases |
|---|---|
| c0224 | UM-BBD |