EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C6H12N2O)1-7.C13H22N6O7 |
| Net Charge | 0 |
| Average Mass | 502.529 |
| Monoisotopic Mass | 502.24996 |
| SMILES | [H]NCCC[C@H](N)CC(=O)N[C@@H]1[C@H](O)[C@@H](OC(N)=O)[C@@H](CO)O[C@H]1/N=C1\N[C@]2([H])C(=O)NC[C@@H](O)[C@@]2([H])N1 |
| InChI | InChI=1S/C19H34N8O8/c20-3-1-2-7(21)4-10(30)24-13-14(31)15(35-18(22)33)9(6-28)34-17(13)27-19-25-11-8(29)5-23-16(32)12(11)26-19/h7-9,11-15,17,28-29,31H,1-6,20-21H2,(H2,22,33)(H,23,32)(H,24,30)(H2,25,26,27)/t7-,8+,9+,11+,12-,13+,14-,15-,17+/m0/s1 |
| InChIKey | NRAUADCLPJTGSF-VLSXYIQESA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| streptothricin (CHEBI:26789) has role metabolite (CHEBI:25212) |
| streptothricin (CHEBI:26789) is a N-glycosyl compound (CHEBI:21731) |
| streptothricin (CHEBI:26789) is a carbamate ester (CHEBI:23003) |
| streptothricin (CHEBI:26789) is a carboxamide (CHEBI:37622) |
| streptothricin (CHEBI:26789) is a guanidines (CHEBI:24436) |
| streptothricin (CHEBI:26789) is a lactam (CHEBI:24995) |
| Incoming Relation(s) |
| streptothricin D (CHEBI:60828) is a streptothricin (CHEBI:26789) |
| streptothricin F (CHEBI:60821) is a streptothricin (CHEBI:26789) |
| Synonyms | Source |
|---|---|
| streptothricins | ChEBI |
| yazumycins | ChEBI |
| racemomycins | ChEBI |