EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30O2 |
| Net Charge | 0 |
| Average Mass | 290.447 |
| Monoisotopic Mass | 290.22458 |
| SMILES | C#CCCCCCCCC1=C(CCCCCCC(=O)O)C1 |
| InChI | InChI=1S/C19H30O2/c1-2-3-4-5-6-7-10-13-17-16-18(17)14-11-8-9-12-15-19(20)21/h1H,3-16H2,(H,20,21) |
| InChIKey | CUWBJXSLCSBCIA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | mitogen A chemical substance that encourages a cell to commence cell division, triggering mitosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sterculynic acid (CHEBI:26757) has role mitogen (CHEBI:52290) |
| sterculynic acid (CHEBI:26757) is a acetylenic fatty acid (CHEBI:25380) |
| sterculynic acid (CHEBI:26757) is a cyclopropenyl fatty acid (CHEBI:23501) |
| sterculynic acid (CHEBI:26757) is a long-chain fatty acid (CHEBI:15904) |
| sterculynic acid (CHEBI:26757) is a polyunsaturated fatty acid (CHEBI:26208) |
| sterculynic acid (CHEBI:26757) is a terminal acetylenic compound (CHEBI:73477) |
| IUPAC Name |
|---|
| 7-(2-non-8-yn-1-ylcycloprop-1-en-1-yl)heptanoic acid |
| Synonyms | Source |
|---|---|
| 8,9-methyleneoctadec-8-en-17-ynoic acid | ChEBI |
| 2-(8-nonynyl)-1-cyclopropene-1-heptanoic acid | ChEBI |
| 9,10-Mt 9c17a-18:2 | ChEBI |
| 9,10-methylene-octadec-9-en-17-ynoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01140016 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5338945 | Reaxys |
| Citations |
|---|