EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24N2O2 |
| Net Charge | 0 |
| Average Mass | 264.369 |
| Monoisotopic Mass | 264.18378 |
| SMILES | [H][C@@]12CCC[N+]3([O-])CCC[C@@]([H])([C@]13[H])[C@@]1([H])CCCC(=O)N1C2 |
| InChI | InChI=1S/C15H24N2O2/c18-14-7-1-6-13-12-5-3-9-17(19)8-2-4-11(15(12)17)10-16(13)14/h11-13,15H,1-10H2/t11-,12+,13+,15-,17?/m0/s1 |
| InChIKey | XVPBINOPNYFXID-LHDUFFHYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ammothamnine (CHEBI:2672) is a alkaloid (CHEBI:22315) |
| Ammothamnine (CHEBI:2672) is a organic molecular entity (CHEBI:50860) |
| Ammothamnine (CHEBI:2672) is a tertiary amine oxide (CHEBI:134363) |
| Synonyms | Source |
|---|---|
| Ammothamnine | KEGG COMPOUND |
| Matrine N-oxide | KEGG COMPOUND |
| oxymatrine | ChEMBL |
| Oxymatrine | KEGG COMPOUND |
| Citations |
|---|