EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:2670 - ammodendrine
| Formula | C12H20N2O |
| Net Charge | 0 |
| Average Mass | 208.305 |
| Monoisotopic Mass | 208.15756 |
| SMILES | [H][C@]1(C2=CN(C(C)=O)CCC2)CCCCN1 |
| InChI | InChI=1S/C12H20N2O/c1-10(15)14-8-4-5-11(9-14)12-6-2-3-7-13-12/h9,12-13H,2-8H2,1H3/t12-/m1/s1 |
| InChIKey | APKLQIQRPUDADG-GFCCVEGCSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ammodendrine (CHEBI:2670) has role plant metabolite (CHEBI:76924) |
| ammodendrine (CHEBI:2670) has role teratogenic agent (CHEBI:50905) |
| ammodendrine (CHEBI:2670) is a N-acylpiperidine (CHEBI:48591) |
| ammodendrine (CHEBI:2670) is a acetamides (CHEBI:22160) |
| ammodendrine (CHEBI:2670) is a piperidine alkaloid (CHEBI:26147) |
| IUPAC Name |
|---|
| 1-{1,2,3,4-tetrahydro-5-[(2R)-piperidin-2-yl]pyridin-1-yl}ethanone |
| Synonyms | Source |
|---|---|
| ammodendrine | KEGG COMPOUND |
| spherocarpine | KEGG COMPOUND |
| 1-acetyl-5-[(2R)-piperidin-2-yl]-1,2,3,4-tetrahydropyridine | IUPAC |
| (+)-spherocarpine | KNApSAcK |
| (+)-ammodendrine | KNApSAcK |
| isoammodendrin | ChEBI |
| Citations |
|---|