EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23N.HCl |
| Net Charge | 0 |
| Average Mass | 313.872 |
| Monoisotopic Mass | 313.15973 |
| SMILES | CN(C)CCC=C1c2ccccc2CCc2ccccc21.Cl |
| InChI | InChI=1S/C20H23N.ClH/c1-21(2)15-7-12-20-18-10-5-3-8-16(18)13-14-17-9-4-6-11-19(17)20;/h3-6,8-12H,7,13-15H2,1-2H3;1H |
| InChIKey | KFYRPLNVJVHZGT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Amitriptyline hydrochloride (CHEBI:2667) has role antidepressant (CHEBI:35469) |
| Amitriptyline hydrochloride (CHEBI:2667) is a organic tricyclic compound (CHEBI:51959) |
| Synonyms | Source |
|---|---|
| Amitriptyline hydrochloride | KEGG COMPOUND |
| Amitriptylini hydrochloridum | ChEMBL |
| Elavil | KEGG COMPOUND |
| Etravil | ChEMBL |
| NIH 10794 | ChEMBL |
| Novoprotect | ChEMBL |
| Brand Names | Source |
|---|---|
| Amitid | ChEMBL |
| Amitril | ChEMBL |
| Amitriptyline hydrochloride component of etrafon-a | ChEMBL |
| Amitriptyline hydrochloride component of limbitrol | ChEMBL |
| Amitriptyline hydrochloride component of limbitrol ds | ChEMBL |
| Cytriptyline | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D00809 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:549-18-8 | KEGG COMPOUND |
| Citations |
|---|