EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H23N3 |
| Net Charge | 0 |
| Average Mass | 293.414 |
| Monoisotopic Mass | 293.18920 |
| SMILES | [H]C(=Nc1ccc(C)cc1C)N(C)C([H])=Nc1ccc(C)cc1C |
| InChI | InChI=1S/C19H23N3/c1-14-6-8-18(16(3)10-14)20-12-22(5)13-21-19-9-7-15(2)11-17(19)4/h6-13H,1-5H3 |
| InChIKey | QXAITBQSYVNQDR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amitraz (CHEBI:2665) has role acaricide (CHEBI:22153) |
| amitraz (CHEBI:2665) has role environmental contaminant (CHEBI:78298) |
| amitraz (CHEBI:2665) has role insecticide (CHEBI:24852) |
| amitraz (CHEBI:2665) has role xenobiotic (CHEBI:35703) |
| amitraz (CHEBI:2665) is a formamidines (CHEBI:51917) |
| amitraz (CHEBI:2665) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N'-(2,4-dimethylphenyl)-N-{[(2,4-dimethylphenyl)imino]methyl}-N-methylmethanimidamide |
| INNs | Source |
|---|---|
| amitraz | WHO MedNet |
| amitraz | WHO MedNet |
| amitraz | WHO MedNet |
| amitrazum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1,5-di(2,4-dimethylphenyl)-3-methyl-1,3,5-triazapenta-1,4-diene | ChemIDplus |
| N,N'-(methyliminodimethylidyne)bis-2,4-xylidine | ChemIDplus |
| Mitac | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2946590 | Reaxys |
| CAS:33089-61-1 | KEGG COMPOUND |
| CAS:33089-61-1 | ChemIDplus |
| CAS:33089-61-1 | NIST Chemistry WebBook |
| Citations |
|---|