EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H29I2NO3.HCl |
| Net Charge | 0 |
| Average Mass | 681.780 |
| Monoisotopic Mass | 681.00037 |
| SMILES | CCCCc1oc2ccccc2c1C(=O)c1cc(I)c(OCCN(CC)CC)c(I)c1.Cl |
| InChI | InChI=1S/C25H29I2NO3.ClH/c1-4-7-11-22-23(18-10-8-9-12-21(18)31-22)24(29)17-15-19(26)25(20(27)16-17)30-14-13-28(5-2)6-3;/h8-10,12,15-16H,4-7,11,13-14H2,1-3H3;1H |
| InChIKey | ITPDYQOUSLNIHG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Amiodarone hydrochloride (CHEBI:2664) has role anti-arrhythmia drug (CHEBI:38070) |
| Amiodarone hydrochloride (CHEBI:2664) has role cardiovascular drug (CHEBI:35554) |
| Amiodarone hydrochloride (CHEBI:2664) is a aromatic ketone (CHEBI:76224) |
| Synonyms | Source |
|---|---|
| Amiodar | ChEMBL |
| Amiodarone hydrochloride | KEGG COMPOUND |
| Cordarone (TN) | KEGG COMPOUND |
| L-3428 | ChEMBL |
| Miodaron | ChEMBL |
| NSC-343341 | ChEMBL |
| Brand Names | Source |
|---|---|
| Amyben | ChEMBL |
| Cordarone | ChEMBL |
| Cordarone x | ChEMBL |
| Cordarone x 100 | ChEMBL |
| Cordarone x 200 | ChEMBL |
| Darmil | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D00636 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:19774-82-4 | KEGG COMPOUND |
| Citations |
|---|