EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H29I2NO3 |
| Net Charge | 0 |
| Average Mass | 645.319 |
| Monoisotopic Mass | 645.02369 |
| SMILES | CCCCc1oc2ccccc2c1C(=O)c1cc(I)c(OCCN(CC)CC)c(I)c1 |
| InChI | InChI=1S/C25H29I2NO3/c1-4-7-11-22-23(18-10-8-9-12-21(18)31-22)24(29)17-15-19(26)25(20(27)16-17)30-14-13-28(5-2)6-3/h8-10,12,15-16H,4-7,11,13-14H2,1-3H3 |
| InChIKey | IYIKLHRQXLHMJQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amiodarone (CHEBI:2663) has role cardiovascular drug (CHEBI:35554) |
| amiodarone (CHEBI:2663) is a 1-benzofurans (CHEBI:38830) |
| amiodarone (CHEBI:2663) is a aromatic ketone (CHEBI:76224) |
| amiodarone (CHEBI:2663) is a organoiodine compound (CHEBI:37142) |
| amiodarone (CHEBI:2663) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| (2-butyl-1-benzofuran-3-yl){4-[2-(diethylamino)ethoxy]-3,5-diiodophenyl}methanone |
| INNs | Source |
|---|---|
| amiodarona | ChemIDplus |
| amiodaronum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Amiodarone | KEGG COMPOUND |
| 2-Butyl-3-(3,5-diiodo-4-(2-diethylaminoethoxy)benzoyl)benzofuran | ChemIDplus |
| 2-Butyl-3-benzofuranyl 4-(2-(diethylamino)ethoxy)-3,5-diiodophenyl ketone | ChemIDplus |
| 2-n-Butyl-3',5'-diiodo-4'-N-diethylaminoethoxy-3-benzoylbenzofuran | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C06823 | KEGG COMPOUND |
| Amiodarone | Wikipedia |
| DB01118 | DrugBank |
| D02910 | KEGG DRUG |
| HMDB0015250 | HMDB |
| TW201400111 | Patent |
| CA2826272 | Patent |
| LSM-2379 | LINCS |
| 176 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1271711 | Beilstein |
| CAS:1951-25-3 | KEGG COMPOUND |
| CAS:1951-25-3 | ChemIDplus |
| Citations |
|---|