EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H8N2.2C7H8N4O2 |
| Net Charge | 0 |
| Average Mass | 420.434 |
| Monoisotopic Mass | 420.19820 |
| SMILES | Cn1c(=O)c2ncnc2n(C)c1=O.Cn1c(=O)c2ncnc2n(C)c1=O.NCCN |
| InChI | InChI=1S/2C7H8N4O2.C2H8N2/c2*1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;3-1-2-4/h2*3H,1-2H3,(H,8,9);1-4H2 |
| InChIKey | FQPFAHBPWDRTLU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. renoprotective agent Any compound that is able to prevent damage to the kidneys. bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. anti-asthmatic agent Any compound that has anti-asthmatic effects. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. cardiotonic drug A drug that has a strengthening effect on the heart or that can increase cardiac output. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aminophylline (CHEBI:2659) has part ethylenediamine (CHEBI:30347) |
| aminophylline (CHEBI:2659) has part theophylline (CHEBI:28177) |
| aminophylline (CHEBI:2659) has role anti-asthmatic agent (CHEBI:65023) |
| aminophylline (CHEBI:2659) has role antihypertensive agent (CHEBI:35674) |
| aminophylline (CHEBI:2659) has role antineoplastic agent (CHEBI:35610) |
| aminophylline (CHEBI:2659) has role bronchodilator agent (CHEBI:35523) |
| aminophylline (CHEBI:2659) has role cardiotonic drug (CHEBI:38147) |
| aminophylline (CHEBI:2659) has role cardiovascular drug (CHEBI:35554) |
| aminophylline (CHEBI:2659) has role renoprotective agent (CHEBI:231911) |
| aminophylline (CHEBI:2659) is a mixture (CHEBI:60004) |
| IUPAC Name |
|---|
| 1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione - ethane-1,2-diamine (2:1) |
| INNs | Source |
|---|---|
| aminofilina | WHO MedNet |
| aminophylline | WHO MedNet |
| aminophylline | WHO MedNet |
| aminophyllinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, compd with 1,2-ethanediamine (2:1) | ChemIDplus |
| Aminophylline | KEGG DRUG |
| BY 108 | ChemIDplus |
| ethylenediamine, compd. with theophylline (1:2) | ChemIDplus |
| NSC-7919 | ChEMBL |
| TAD | ChemIDplus |
| Brand Names | Source |
|---|---|
| Aminocardol | ChemIDplus |
| Aminodur | ChemIDplus |
| Aminodur dura-tabs | ChemIDplus |
| Aminofillina | ChemIDplus |
| Aminophyllin | ChemIDplus |
| Aminophylline dye free | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| Aminophylline | Wikipedia |
| D00227 | KEGG DRUG |
| DB01223 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:317-34-0 | ChemIDplus |
| CAS:317-34-0 | KEGG DRUG |
| Citations |
|---|