EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H8N2.2C7H8N4O2 |
| Net Charge | 0 |
| Average Mass | 420.434 |
| Monoisotopic Mass | 420.19820 |
| SMILES | Cn1c(=O)c2ncnc2n(C)c1=O.Cn1c(=O)c2ncnc2n(C)c1=O.NCCN |
| InChI | InChI=1S/2C7H8N4O2.C2H8N2/c2*1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;3-1-2-4/h2*3H,1-2H3,(H,8,9);1-4H2 |
| InChIKey | FQPFAHBPWDRTLU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. cardiotonic drug A drug that has a strengthening effect on the heart or that can increase cardiac output. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aminophylline (CHEBI:2659) has part ethylenediamine (CHEBI:30347) |
| aminophylline (CHEBI:2659) has part theophylline (CHEBI:28177) |
| aminophylline (CHEBI:2659) has role bronchodilator agent (CHEBI:35523) |
| aminophylline (CHEBI:2659) has role cardiotonic drug (CHEBI:38147) |
| aminophylline (CHEBI:2659) is a mixture (CHEBI:60004) |
| IUPAC Name |
|---|
| 1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione - ethane-1,2-diamine (2:1) |
| INNs | Source |
|---|---|
| aminophyllinum | WHO MedNet |
| aminophylline | WHO MedNet |
| aminofilina | WHO MedNet |
| aminophylline | WHO MedNet |
| Synonyms | Source |
|---|---|
| Aminophylline | KEGG DRUG |
| theophyline ethylenediamine | ChemIDplus |
| ethylenediamine, compd. with theophylline (1:2) | ChemIDplus |
| 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, compd with 1,2-ethanediamine (2:1) | ChemIDplus |
| BY 108 | ChemIDplus |
| TAD | ChemIDplus |
| Brand Names | Source |
|---|---|
| Somophyllin | KEGG DRUG |
| Theophylline ethylenediamine | KEGG DRUG |
| Theophyllin aethylendiamin | ChemIDplus |
| Cardophylin | ChemIDplus |
| Aminodur | ChemIDplus |
| Cardiofilina | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D00227 | KEGG DRUG |
| DB01223 | DrugBank |
| Aminophylline | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:317-34-0 | KEGG DRUG |
| CAS:317-34-0 | ChemIDplus |
| Citations |
|---|