EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H43N5O13.2H2O4S |
| Net Charge | 0 |
| Average Mass | 781.766 |
| Monoisotopic Mass | 781.22050 |
| SMILES | NCC[C@H](O)C(=O)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O.O=S(=O)(O)O.O=S(=O)(O)O |
| InChI | InChI=1S/C22H43N5O13.2H2O4S/c23-2-1-8(29)20(36)27-7-3-6(25)18(39-22-16(34)15(33)13(31)9(4-24)37-22)17(35)19(7)40-21-14(32)11(26)12(30)10(5-28)38-21;2*1-5(2,3)4/h6-19,21-22,28-35H,1-5,23-26H2,(H,27,36);2*(H2,1,2,3,4)/t6-,7+,8-,9+,10+,11-,12+,13+,14+,15-,16+,17-,18+,19-,21+,22+;;/m0../s1 |
| InChIKey | FXKSEJFHKVNEFI-GCZBSULCSA-N |
| Roles Classification |
|---|
| Biological Roles: | nephrotoxic agent A role played by any chemical compound (natural or synthetic) exhibiting itself through the ability to induce damage to the kidneys. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antibacterial drug A drug used to treat or prevent bacterial infections. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amikacin disulfate (CHEBI:2638) has part amikacin(4+) (CHEBI:84739) |
| amikacin disulfate (CHEBI:2638) has role antibacterial drug (CHEBI:36047) |
| amikacin disulfate (CHEBI:2638) has role antimicrobial agent (CHEBI:33281) |
| amikacin disulfate (CHEBI:2638) has role nephrotoxic agent (CHEBI:50909) |
| amikacin disulfate (CHEBI:2638) is a aminoglycoside sulfate salt (CHEBI:38012) |
| IUPAC Name |
|---|
| (2S)-4-amino-N-[(1R,2S,3S,4R,5S)-5-amino-2-(3-amino-3-deoxy-α-D-glucopyranosyloxy)-4-(6-amino-6-deoxy-α-D-glucopyranosyloxy)-3-hydroxycyclohexyl]-2-hydroxybutanamide disulfate |
| Synonyms | Source |
|---|---|
| amikacin bis(sulphate) | ChemIDplus |
| amikacin disulfate | ChemIDplus |
| amikacin disulphate | ChEBI |
| Amikacin sulfate | KEGG COMPOUND |
| O-3-amino-3-deoxy-α-D-glucopyranosyl-(1→4)-O-(6-amino-6-deoxy-α-D-glucopyranosyl-(1→6))-N3-(4-amino-L-2-hydroxybutyryl)-2-deoxy-L-streptamine sulfate (1:2) | ChemIDplus |
| Pierami | ChemIDplus |
| Brand Names | Source |
|---|---|
| Amicacin | DrugBank |
| Amiglyde-V | DrugBank |
| Amikan | ChEBI |
| Amikavet | DrugBank |
| Amikin | DrugBank |
| Briclin | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6172633 | Reaxys |
| CAS:39831-55-5 | ChemIDplus |
| CAS:39831-55-5 | KEGG COMPOUND |
| Citations |
|---|