EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H43N5O13 |
| Net Charge | 0 |
| Average Mass | 585.608 |
| Monoisotopic Mass | 585.28574 |
| SMILES | NCC[C@H](O)C(=O)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O |
| InChI | InChI=1S/C22H43N5O13/c23-2-1-8(29)20(36)27-7-3-6(25)18(39-22-16(34)15(33)13(31)9(4-24)37-22)17(35)19(7)40-21-14(32)11(26)12(30)10(5-28)38-21/h6-19,21-22,28-35H,1-5,23-26H2,(H,27,36)/t6-,7+,8-,9+,10+,11-,12+,13+,14+,15-,16+,17-,18+,19-,21+,22+/m0/s1 |
| InChIKey | LKCWBDHBTVXHDL-RMDFUYIESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | nephrotoxic agent A role played by any chemical compound (natural or synthetic) exhibiting itself through the ability to induce damage to the kidneys. antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amikacin (CHEBI:2637) has functional parent kanamycin A (CHEBI:17630) |
| amikacin (CHEBI:2637) has role antibacterial drug (CHEBI:36047) |
| amikacin (CHEBI:2637) has role antimicrobial agent (CHEBI:33281) |
| amikacin (CHEBI:2637) has role nephrotoxic agent (CHEBI:50909) |
| amikacin (CHEBI:2637) is a amino cyclitol glycoside (CHEBI:22479) |
| amikacin (CHEBI:2637) is a aminoglycoside (CHEBI:47779) |
| amikacin (CHEBI:2637) is a carboxamide (CHEBI:37622) |
| amikacin (CHEBI:2637) is a α-D-glucoside (CHEBI:22390) |
| amikacin (CHEBI:2637) is conjugate base of amikacin(4+) (CHEBI:84739) |
| Incoming Relation(s) |
| amikacin(4+) (CHEBI:84739) is conjugate acid of amikacin (CHEBI:2637) |
| IUPAC Name |
|---|
| (2S)-4-amino-N-[(1R,2S,3S,4R,5S)-5-amino-2-(3-amino-3-deoxy-α-D-glucopyranosyloxy)-4-(6-amino-6-deoxy-α-D-glucopyranosyloxy)-3-hydroxycyclohexyl]-2-hydroxybutanamide |
| INNs | Source |
|---|---|
| amikacin | ChemIDplus |
| amikacina | ChemIDplus |
| amikacine | ChemIDplus |
| amikacinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-N-(L(−)-γ-amino-α-hydroxybutyryl)kanamycin A | ChemIDplus |
| Amikacin | KEGG COMPOUND |
| O-3-amino-3-deoxy-α-D-glucopyranosyl-(1→4)-O-(6-amino-6-deoxy-α-D-glucopyranosyl-(1→6))-N3-(4-amino-L-2-hydroxybutyryl)-2-deoxy-L-streptamine | ChemIDplus |
| Brand Names | Source |
|---|---|
| Amicacin | DrugBank |
| Amiglyde-V | DrugBank |
| Amikavet | DrugBank |
| Briclin | DrugBank |
| Citations |
|---|