EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H24F6N4 |
| Net Charge | 0 |
| Average Mass | 494.483 |
| Monoisotopic Mass | 494.19052 |
| SMILES | [H]C(C(=NN=C1NCC(C)(C)CN1)C([H])=C([H])c1ccc(C(F)(F)F)cc1)=C([H])c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H24F6N4/c1-23(2)15-32-22(33-16-23)35-34-21(13-7-17-3-9-19(10-4-17)24(26,27)28)14-8-18-5-11-20(12-6-18)25(29,30)31/h3-14H,15-16H2,1-2H3,(H2,32,33,35) |
| InChIKey | IQVNEKKDSLOHHK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | |
| Application: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydramethylnon (CHEBI:2630) has role insecticide (CHEBI:24852) |
| hydramethylnon (CHEBI:2630) has role mitochondrial cytochrome-bc1 complex inhibitor (CHEBI:38499) |
| hydramethylnon (CHEBI:2630) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| hydramethylnon (CHEBI:2630) is a guanidines (CHEBI:24436) |
| hydramethylnon (CHEBI:2630) is a hydrazone (CHEBI:38532) |
| hydramethylnon (CHEBI:2630) is a olefinic compound (CHEBI:78840) |
| hydramethylnon (CHEBI:2630) is a pyrimidines (CHEBI:39447) |
| Incoming Relation(s) |
| (E,E)-hydramethylnon (CHEBI:38531) is a hydramethylnon (CHEBI:2630) |
| IUPAC Name |
|---|
| 5,5-dimethyltetrahydropyrimidin-2(1H)-one (3-[4-(trifluoromethyl)phenyl]-1-{2-[4-(trifluoromethyl)phenyl]ethenyl}prop-2-en-1-ylidene)hydrazone |
| Synonyms | Source |
|---|---|
| Hydramethylnon | KEGG COMPOUND |
| Maxforce | ChEBI |
| tetrahydro-5,5-dimethyl-2(1H)-pyrimidinone (1,5-bis(α,α,α-trifluoro-p-tolyl)-1,4-pentadien-3-one)hydrazone | ChemIDplus |
| tetrahydro-5,5-dimethyl-2(1H)-pyrimidinone (3-(4-(trifluoromethyl)phenyl)-1-(2-(4-(trifluoromethyl)phenyl)ethenyl)-2-propenylidene)hydrazone | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6015162 | Reaxys |
| CAS:67485-29-4 | NIST Chemistry WebBook |
| CAS:67485-29-4 | ChemIDplus |
| CAS:67485-29-4 | KEGG COMPOUND |
| Citations |
|---|