EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H42Cl2N4O2.2Cl |
| Net Charge | 0 |
| Average Mass | 608.482 |
| Monoisotopic Mass | 606.20619 |
| SMILES | CC[N+](CC)(CCNC(=O)C(=O)NCC[N+](CC)(CC)Cc1ccccc1Cl)Cc1ccccc1Cl.[Cl-].[Cl-] |
| InChI | InChI=1S/C28H40Cl2N4O2.2ClH/c1-5-33(6-2,21-23-13-9-11-15-25(23)29)19-17-31-27(35)28(36)32-18-20-34(7-3,8-4)22-24-14-10-12-16-26(24)30;;/h9-16H,5-8,17-22H2,1-4H3;2*1H |
| InChIKey | DXUUXWKFVDVHIK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | neurotransmitter agent A substance used for its pharmacological action on any aspect of neurotransmitter systems. Neurotransmitter agents include agonists, antagonists, degradation inhibitors, uptake inhibitors, depleters, precursors, and modulators of receptor function. EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). |
| Application: | neurotransmitter agent A substance used for its pharmacological action on any aspect of neurotransmitter systems. Neurotransmitter agents include agonists, antagonists, degradation inhibitors, uptake inhibitors, depleters, precursors, and modulators of receptor function. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ambenonium chloride (CHEBI:2628) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| ambenonium chloride (CHEBI:2628) has role neurotransmitter agent (CHEBI:35942) |
| ambenonium chloride (CHEBI:2628) is a organic chloride salt (CHEBI:36094) |
| ambenonium chloride (CHEBI:2628) is a quaternary ammonium salt (CHEBI:35273) |
| IUPAC Name |
|---|
| 2,2'-[(1,2-dioxoethane-1,2-diyl)diimino]bis[N-(2-chlorobenzyl)-N,N-diethylethanaminium] dichloride |
| INNs | Source |
|---|---|
| ambenonium chloride | KEGG DRUG |
| ambenonii chloridum | ChemIDplus |
| Chlorure d'ambenonium | ChemIDplus |
| Cloruro de ambenonio | ChemIDplus |
| Synonyms | Source |
|---|---|
| (Oxalylbis(iminoethylene))bis((o-chlorobenzyl)diethylammonium) dichloride | ChemIDplus |
| Ambenonium dichloride | ChemIDplus |
| Ambestigmin chloride | ChemIDplus |
| N,N'-Bis(2-diethylaminoethyl)oxamide bis(2-chlorobenzyl chloride) | ChemIDplus |
| Citations |
|---|