EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H42Cl2N4O2.2Cl |
| Net Charge | 0 |
| Average Mass | 608.482 |
| Monoisotopic Mass | 606.20619 |
| SMILES | CC[N+](CC)(CCNC(=O)C(=O)NCC[N+](CC)(CC)Cc1ccccc1Cl)Cc1ccccc1Cl.[Cl-].[Cl-] |
| InChI | InChI=1S/C28H40Cl2N4O2.2ClH/c1-5-33(6-2,21-23-13-9-11-15-25(23)29)19-17-31-27(35)28(36)32-18-20-34(7-3,8-4)22-24-14-10-12-16-26(24)30;;/h9-16H,5-8,17-22H2,1-4H3;2*1H |
| InChIKey | DXUUXWKFVDVHIK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). neurotransmitter agent A substance used for its pharmacological action on any aspect of neurotransmitter systems. Neurotransmitter agents include agonists, antagonists, degradation inhibitors, uptake inhibitors, depleters, precursors, and modulators of receptor function. |
| Application: | neurotransmitter agent A substance used for its pharmacological action on any aspect of neurotransmitter systems. Neurotransmitter agents include agonists, antagonists, degradation inhibitors, uptake inhibitors, depleters, precursors, and modulators of receptor function. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ambenonium chloride (CHEBI:2628) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| ambenonium chloride (CHEBI:2628) has role neurotransmitter agent (CHEBI:35942) |
| ambenonium chloride (CHEBI:2628) is a organic chloride salt (CHEBI:36094) |
| ambenonium chloride (CHEBI:2628) is a quaternary ammonium salt (CHEBI:35273) |
| IUPAC Name |
|---|
| 2,2'-[(1,2-dioxoethane-1,2-diyl)diimino]bis[N-(2-chlorobenzyl)-N,N-diethylethanaminium] dichloride |
| INNs | Source |
|---|---|
| ambenonii chloridum | ChemIDplus |
| ambenonium chloride | KEGG DRUG |
| Chlorure d'ambenonium | ChemIDplus |
| Cloruro de ambenonio | ChemIDplus |
| Synonyms | Source |
|---|---|
| Ambenonium dichloride | ChemIDplus |
| Ambestigmin chloride | ChemIDplus |
| N,N'-Bis(2-diethylaminoethyl)oxamide bis(2-chlorobenzyl chloride) | ChemIDplus |
| (Oxalylbis(iminoethylene))bis((o-chlorobenzyl)diethylammonium) dichloride | ChemIDplus |
| Citations |
|---|