EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H19N5S |
| Net Charge | 0 |
| Average Mass | 241.364 |
| Monoisotopic Mass | 241.13612 |
| SMILES | CSc1nc(NC(C)C)nc(NC(C)C)n1 |
| InChI | InChI=1S/C10H19N5S/c1-6(2)11-8-13-9(12-7(3)4)15-10(14-8)16-5/h6-7H,1-5H3,(H2,11,12,13,14,15) |
| InChIKey | AAEVYOVXGOFMJO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prometryn (CHEBI:26276) has role environmental contaminant (CHEBI:78298) |
| prometryn (CHEBI:26276) has role herbicide (CHEBI:24527) |
| prometryn (CHEBI:26276) has role xenobiotic (CHEBI:35703) |
| prometryn (CHEBI:26276) is a diamino-1,3,5-triazine (CHEBI:38170) |
| prometryn (CHEBI:26276) is a methylthio-1,3,5-triazine (CHEBI:38174) |
| IUPAC Name |
|---|
| 6-(methylsulfanyl)-N,N'-di(propan-2-yl)-1,3,5-triazine-2,4-diamine |
| Synonyms | Source |
|---|---|
| 2-(methylthio)-4,6-bis(isopropylamino)-s-triazine | NIST Chemistry WebBook |
| N,N'-bis(1-methylethyl)-6-methylthio-1,3,5-triazine-2,4-diamine | NIST Chemistry WebBook |
| N,N'-diisopropyl-6-(methylthio)-1,3,5-triazine-2,4-diamine | ChEBI |
| Prometryn | UM-BBD |
| Prometryne | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 542 | PPDB |
| c0255 | UM-BBD |
| C18542 | KEGG COMPOUND |
| CN101971818 | Patent |
| CN101971820 | Patent |
| CPD-9344 | MetaCyc |
| LSM-20941 | LINCS |
| prometryn | Alan Wood's Pesticides |
| Citations |
|---|