EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H42Cl2N4O2 |
| Net Charge | +2 |
| Average Mass | 537.576 |
| Monoisotopic Mass | 536.26738 |
| SMILES | CC[N+](CC)(CCNC(=O)C(=O)NCC[N+](CC)(CC)Cc1ccccc1Cl)Cc1ccccc1Cl |
| InChI | InChI=1S/C28H40Cl2N4O2/c1-5-33(6-2,21-23-13-9-11-15-25(23)29)19-17-31-27(35)28(36)32-18-20-34(7-3,8-4)22-24-14-10-12-16-26(24)30/h9-16H,5-8,17-22H2,1-4H3/p+2 |
| InChIKey | OMHBPUNFVFNHJK-UHFFFAOYSA-P |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ambenonium (CHEBI:2627) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| ambenonium (CHEBI:2627) is a quaternary ammonium ion (CHEBI:35267) |
| IUPAC Name |
|---|
| 2,2'-[(1,2-dioxoethane-1,2-diyl)diimino]bis[N-(2-chlorobenzyl)-N,N-diethylethanaminium] |
| Synonyms | Source |
|---|---|
| Ambenonium | KEGG COMPOUND |
| Ambenonium Base | ChemIDplus |
| Ambenonum | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C07773 | KEGG COMPOUND |
| Ambenonium | Wikipedia |
| DB01122 | DrugBank |
| 146 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4168740 | Beilstein |
| CAS:7648-98-8 | KEGG COMPOUND |
| CAS:7648-98-8 | ChemIDplus |