EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H48N4O6 |
| Net Charge | 0 |
| Average Mass | 716.879 |
| Monoisotopic Mass | 716.35739 |
| SMILES | [H][C@@]12C[C@]34CN5c6c(OC)cccc6[C@@]6(CCN7CC[C@]8([H])OCC[C@]8(C1)[C@]76[H])[C@@]52O[C@@]3([H])N1CC[C@]23C(=C(C(=O)OC)C[C@@]5(CCO[C@]54[H])[C@]12[H])Nc1ccccc13 |
| InChI | InChI=1S/C43H48N4O6/c1-49-29-9-5-7-27-31(29)47-23-40-21-24-20-38-13-18-51-30(38)10-15-45-16-12-42(27,35(38)45)43(24,47)53-37(40)46-17-11-41-26-6-3-4-8-28(26)44-32(41)25(33(48)50-2)22-39(34(41)46)14-19-52-36(39)40/h3-9,24,30,34-37,44H,10-23H2,1-2H3/t24-,30-,34-,35-,36+,37+,38+,39-,40+,41-,42+,43+/m0/s1 |
| InChIKey | RZBFPDQKWUWUCK-SFUBKHQQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Voacanga africana (ncbitaxon:141630) | root (BTO:0001188) | PubMed (25052206) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amataine (CHEBI:2625) has role plant metabolite (CHEBI:76924) |
| amataine (CHEBI:2625) is a aromatic ether (CHEBI:35618) |
| amataine (CHEBI:2625) is a bridged compound (CHEBI:35990) |
| amataine (CHEBI:2625) is a indole alkaloid (CHEBI:38958) |
| amataine (CHEBI:2625) is a methyl ester (CHEBI:25248) |
| amataine (CHEBI:2625) is a organic heteropolycyclic compound (CHEBI:38166) |
| amataine (CHEBI:2625) is a spiro compound (CHEBI:33599) |
| IUPAC Name |
|---|
| methyl ent-6β,21;8β,2';6'β,21'-triepoxy-17'-methoxy-2,3-didehydro-(7αC4'',3'β)-3',4''-dihydro-2'H-spiro[aspidospermidine-7,5''-pyrido[1',2',3':1,2,3]aspidospermidine]-3-carboxylate |
| Synonyms | Source |
|---|---|
| Amataine | KEGG COMPOUND |
| Subssesiline | KEGG COMPOUND |
| Grandifoline | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1070890 | Reaxys |
| CAS:31148-60-4 | KEGG COMPOUND |
| CAS:31148-60-4 | ChemIDplus |
| Citations |
|---|