EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H38N4O8 |
| Net Charge | 0 |
| Average Mass | 474.555 |
| Monoisotopic Mass | 474.26896 |
| SMILES | CC(C)C[C@@H](N)[C@H](O)C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](CC(=O)O)C(=O)O)C(C)C)C(C)C |
| InChI | InChI=1S/C21H38N4O8/c1-9(2)7-12(22)17(28)20(31)25-16(11(5)6)19(30)24-15(10(3)4)18(29)23-13(21(32)33)8-14(26)27/h9-13,15-17,28H,7-8,22H2,1-6H3,(H,23,29)(H,24,30)(H,25,31)(H,26,27)(H,32,33)/t12-,13+,15+,16+,17+/m1/s1 |
| InChIKey | QFAADIRHLBXJJS-ZAZJUGBXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | protease inhibitor A compound which inhibits or antagonizes the biosynthesis or actions of proteases (endopeptidases). EC 3.4.11.* (aminopeptidase) inhibitor An EC 3.4.* (hydrolases acting on peptide bond) inhibitor that interferes wtih the action of any aminopeptidase (EC 3.4.11.*). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amastatin (CHEBI:2624) has role EC 3.4.11.* (aminopeptidase) inhibitor (CHEBI:76787) |
| amastatin (CHEBI:2624) has role protease inhibitor (CHEBI:37670) |
| amastatin (CHEBI:2624) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| N-[(2S,3R)-3-amino-2-hydroxy-5-methylhexanoyl]-L-valyl-L-valyl-L-aspartic acid |
| Synonyms | Source |
|---|---|
| Amastatin | KEGG COMPOUND |
| Leu[1ψ,CHOHCONH]ValValAsp | IUBMB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:24145991 | Reaxys |
| Reaxys:4727847 | Reaxys |
| CAS:67655-94-1 | ChemIDplus |
| CAS:67655-94-1 | KEGG COMPOUND |
| Citations |
|---|