EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5NO4 |
| Net Charge | 0 |
| Average Mass | 167.120 |
| Monoisotopic Mass | 167.02186 |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C7H5NO4/c9-7(10)5-1-3-6(4-2-5)8(11)12/h1-4H,(H,9,10) |
| InChIKey | OTLNPYWUJOZPPA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-nitrobenzoic acid (CHEBI:262350) has functional parent benzoic acid (CHEBI:30746) |
| 4-nitrobenzoic acid (CHEBI:262350) is a nitrobenzoic acid (CHEBI:25553) |
| 4-nitrobenzoic acid (CHEBI:262350) is conjugate acid of 4-nitrobenzoate (CHEBI:142863) |
| Incoming Relation(s) |
| 2-[(benzoylamino)methyl]-3,4,6-trichlorophenyl 4-nitrobenzoate (CHEBI:75336) has functional parent 4-nitrobenzoic acid (CHEBI:262350) |
| 4-nitrobenzoate (CHEBI:142863) is conjugate base of 4-nitrobenzoic acid (CHEBI:262350) |
| p-nitrobenzoyl group (CHEBI:60546) is substituent group from 4-nitrobenzoic acid (CHEBI:262350) |
| IUPAC Name |
|---|
| 4-nitrobenzoic acid |
| Synonyms | Source |
|---|---|
| nitrodracylic acid | ChemIDplus |
| p-nitrobenzenecarboxylic acid | ChemIDplus |
| 1-carboxy-4-nitrobenzene | ChemIDplus |
| p-nitrobenzoic acid | ChemIDplus |
| 4-nitrodracylic acid | ChemIDplus |
| p-nitrodracylic acid | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| C18625 | KEGG COMPOUND |
| 4NB | PDBeChem |
| 4-Nitrobenzoic_acid | Wikipedia |
| CN101407464 | Patent |
| Citations |
|---|