EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20N4 |
| Net Charge | 0 |
| Average Mass | 316.408 |
| Monoisotopic Mass | 316.16880 |
| SMILES | c1cc2nc1Cc1ccc(n1)Cc1ccc(n1)Cc1ccc(n1)C2 |
| InChI | InChI=1S/C20H20N4/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14/h1-8,21-24H,9-12H2 |
| InChIKey | VCRBUDCZLSQJPZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| porphyrinogen (CHEBI:26213) is a calixpyrrole (CHEBI:51388) |
| porphyrinogen (CHEBI:26213) is a porphyrinogens (CHEBI:36321) |
| porphyrinogen (CHEBI:26213) is a tetrapyrrole fundamental parent (CHEBI:35794) |
| IUPAC Names |
|---|
| 5,10,15,20,22,24-hexahydroporphyrin |
| porphyrinogen |
| Synonym | Source |
|---|---|
| calix[4]pyrrole | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7545460 | Beilstein |