EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H34N2O19 |
| Net Charge | 0 |
| Average Mass | 726.597 |
| Monoisotopic Mass | 726.17558 |
| SMILES | O=C(O)C1=C/C(=C/C=[N+]2/c3cc(O)c(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]4O)cc3C[C@H]2C(=O)[O-])C[C@@H](C(=O)O)N1 |
| InChI | InChI=1S/C30H34N2O19/c33-8-17-18(35)20(37)24(51-29-22(39)19(36)21(38)23(50-29)28(46)47)30(49-17)48-16-6-10-5-14(27(44)45)32(13(10)7-15(16)34)2-1-9-3-11(25(40)41)31-12(4-9)26(42)43/h1-3,6-7,12,14,17-24,29-30,33,35-39H,4-5,8H2,(H5,34,40,41,42,43,44,45,46,47)/t12-,14-,17+,18+,19-,20-,21-,22+,23-,24+,29-,30+/m0/s1 |
| InChIKey | ATSKDYKYMQVTGH-POBNKHOBSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. biological pigment An endogenous molecular entity that results in a colour of an organism as the consequence of the selective absorption of light. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amaranthin (CHEBI:2621) has functional parent betanidin (CHEBI:3079) |
| amaranthin (CHEBI:2621) has role biological pigment (CHEBI:26130) |
| amaranthin (CHEBI:2621) has role plant metabolite (CHEBI:76924) |
| amaranthin (CHEBI:2621) is a disaccharide derivative (CHEBI:63353) |
| amaranthin (CHEBI:2621) is a indoles (CHEBI:24828) |
| amaranthin (CHEBI:2621) is a olefinic compound (CHEBI:78840) |
| amaranthin (CHEBI:2621) is a tetrahydropyridine (CHEBI:26921) |
| IUPAC Name |
|---|
| (1E,2S)-1-{(2E)-2-[(2S)-2,6-dicarboxy-2,3-dihydropyridin-4(1H)-ylidene]ethylidene}-5-[(β-D-glucopyranosyluronic acid)-(1→2)-β-D-glucopyranosyloxy]-6-hydroxy-2,3-dihydro-1H-indolium-2-carboxylate |
| Synonyms | Source |
|---|---|
| Amaranthin | KEGG COMPOUND |
| Amaranthin betacyanin | ChemIDplus |
| Amarantin | ChemIDplus |
| betanidin 5-O-sophorobiuronic acid | MetaCyc |
| betanidin 5-O-β-[1''→2']-glucuronosyl-β-glucoside | MetaCyc |
| Manual Xrefs | Databases |
|---|---|
| C00001581 | KNApSAcK |
| C08537 | KEGG COMPOUND |
| CPD-8658 | MetaCyc |
| HMDB0029406 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8183321 | Reaxys |
| CAS:15167-84-7 | ChemIDplus |
| CAS:15167-84-7 | KEGG COMPOUND |