EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18N.Cl |
| Net Charge | 0 |
| Average Mass | 187.714 |
| Monoisotopic Mass | 187.11278 |
| SMILES | [Cl-].[NH3+]C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C10H17N.ClH/c11-10-4-7-1-8(5-10)3-9(2-7)6-10;/h7-9H,1-6,11H2;1H |
| InChIKey | WOLHOYHSEKDWQH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | dopamine agonist A drug that binds to and activates dopamine receptors. antiviral agent A substance that destroys or inhibits replication of viruses. NMDA receptor antagonist Any substance that inhibits the action of N-methyl-D-aspartate (NMDA) receptors. They tend to induce a state known as dissociative anesthesia, marked by catalepsy, amnesia, and analgesia, while side effects can include hallucinations, nightmares, and confusion. Due to their psychotomimetic effects, many NMDA receptor antagonists are used as recreational drugs. |
| Application: | dopamine agonist A drug that binds to and activates dopamine receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amantadine hydrochloride (CHEBI:2619) has part adamantan-1-aminium (CHEBI:48320) |
| amantadine hydrochloride (CHEBI:2619) has role antiviral agent (CHEBI:22587) |
| amantadine hydrochloride (CHEBI:2619) has role dopamine agonist (CHEBI:51065) |
| amantadine hydrochloride (CHEBI:2619) has role NMDA receptor antagonist (CHEBI:60643) |
| amantadine hydrochloride (CHEBI:2619) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| adamantan-1-aminium chloride |
| Synonyms | Source |
|---|---|
| 1-Adamantanamine hydrochloride | ChemIDplus |
| 1-Adamantylamine hydrochloride | ChemIDplus |
| 1-Aminoadamantane hydrochloride | ChemIDplus |
| 1-Aminoadamantene hydrochlorid | ChemIDplus |
| Amantadine hydrochloride | KEGG COMPOUND |
| tricyclo[3.3.1.13,7]decan-1-aminium chloride | IUPAC |
| Brand Name | Source |
|---|---|
| Symmetrel | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| Amantadine | Wikipedia |
| C07939 | KEGG COMPOUND |
| D00777 | KEGG DRUG |
| DB00915 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4198854 | Reaxys |
| Gmelin:838463 | Gmelin |
| CAS:665-66-7 | ChemIDplus |
| CAS:665-66-7 | KEGG COMPOUND |
| Citations |
|---|