EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:2617 - amabiline
| Formula | C15H25NO4 |
| Net Charge | 0 |
| Average Mass | 283.368 |
| Monoisotopic Mass | 283.17836 |
| SMILES | [H][C@@]12CCCN1CC=C2COC(=O)[C@](O)(C(C)C)[C@H](C)O |
| InChI | InChI=1S/C15H25NO4/c1-10(2)15(19,11(3)17)14(18)20-9-12-6-8-16-7-4-5-13(12)16/h6,10-11,13,17,19H,4-5,7-9H2,1-3H3/t11-,13-,15-/m0/s1 |
| InChIKey | DRVWTOSBCBKXOR-WHOFXGATSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cynoglossum amabile (ncbitaxon:354628) | - | PubMed (22432912) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amabiline (CHEBI:2617) has role plant metabolite (CHEBI:76924) |
| amabiline (CHEBI:2617) is a butyrate ester (CHEBI:50477) |
| amabiline (CHEBI:2617) is a carboxylic ester (CHEBI:33308) |
| amabiline (CHEBI:2617) is a pyrrolizidine alkaloid (CHEBI:64948) |
| amabiline (CHEBI:2617) is a pyrrolizines (CHEBI:38522) |
| amabiline (CHEBI:2617) is a secondary alcohol (CHEBI:35681) |
| amabiline (CHEBI:2617) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (7aS)-2,3,5,7a-tetrahydro-1H-pyrrolizin-7-ylmethyl (2S,3S)-2,3-dihydroxy-2-(propan-2-yl)butanoate |
| Synonyms | Source |
|---|---|
| Amabiline | KEGG COMPOUND |
| Butanoic acid, 2,3-dihydroxy-2-(1-methylethyl)-, (2,3,5,7a-tetrahydro-1H-pyrrolidizin-7-yl)methyl ester | KEGG COMPOUND |
| Citations |
|---|