EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5BiO4 |
| Net Charge | 0 |
| Average Mass | 362.093 |
| Monoisotopic Mass | 361.99918 |
| SMILES | O=C1[O][Bi]([OH])[O]c2ccccc21 |
| InChI | InChI=1S/C7H6O3.Bi.H2O/c8-6-4-2-1-3-5(6)7(9)10;;/h1-4,8H,(H,9,10);;1H2/q;+3;/p-3 |
| InChIKey | ZREIPSZUJIFJNP-UHFFFAOYSA-K |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Applications: | antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bismuth subsalicylate (CHEBI:261649) has role antibacterial agent (CHEBI:33282) |
| bismuth subsalicylate (CHEBI:261649) has role antiemetic (CHEBI:50919) |
| bismuth subsalicylate (CHEBI:261649) has role antineoplastic agent (CHEBI:35610) |
| bismuth subsalicylate (CHEBI:261649) is a bismuth coordination entity (CHEBI:37384) |
| bismuth subsalicylate (CHEBI:261649) is a salicylates (CHEBI:26596) |
| IUPAC Name |
|---|
| 2-hydroxy-4H-1,3,2-benzodioxabismin-4-one |
| Synonyms | Source |
|---|---|
| 2-Hydroxy-benzo[1,3,2]dioxabismin-4-one | ChEMBL |
| basic bismuth salicylate | ChemIDplus |
| bismuth oxide salicylate | ChemIDplus |
| bismuth oxysalicylate | ChemIDplus |
| Bismuth salicylate | ChEMBL |
| Bismuth subsalicylate | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Bismukote | ChEMBL |
| Bismuth subsalicylate component of helidac | ChEMBL |
| Corrective suspension | ChEMBL |
| Gastro-cote | ChEMBL |
| Pepto-bismol | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Gmelin:314795 | Gmelin |
| CAS:14882-18-9 | KEGG COMPOUND |
| CAS:14882-18-9 | ChemIDplus |
| Citations |
|---|