EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H40O |
| Net Charge | 0 |
| Average Mass | 296.539 |
| Monoisotopic Mass | 296.30792 |
| SMILES | C/C(=C\CO)CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C20H40O/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21/h15,17-19,21H,6-14,16H2,1-5H3/b20-15+/t18-,19-/m1/s1 |
| InChIKey | BOTWFXYSPFMFNR-PYDDKJGSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. |
| Application: | schistosomicide drug Drugs that used to treat infestations by flukes (trematodes) of the genus Schistosoma. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phytol (CHEBI:17327) has role algal metabolite (CHEBI:84735) |
| phytol (CHEBI:17327) has role plant metabolite (CHEBI:76924) |
| phytol (CHEBI:17327) has role schistosomicide drug (CHEBI:38941) |
| phytol (CHEBI:17327) is a diterpenoid (CHEBI:23849) |
| phytol (CHEBI:17327) is a long-chain primary fatty alcohol (CHEBI:77396) |
| Incoming Relation(s) |
| fatty acid phytyl ester (CHEBI:177021) has functional parent phytol (CHEBI:17327) |
| phytyl diphosphate (CHEBI:75837) has functional parent phytol (CHEBI:17327) |
| phytyl phosphate (CHEBI:75838) has functional parent phytol (CHEBI:17327) |
| IUPAC Name |
|---|
| (2E,7R,11R)-3,7,11,15-tetramethylhexadec-2-en-1-ol |
| Synonyms | Source |
|---|---|
| (2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecen-1-ol | ChEBI |
| Phytol | KEGG COMPOUND |
| trans-Phytol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| phytol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00003467 | KNApSAcK |
| C01389 | KEGG COMPOUND |
| HMDB0002019 | HMDB |
| LMPR0104010002 | LIPID MAPS |
| PHYTOL | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7855349 | Reaxys |
| CAS:150-86-7 | KEGG COMPOUND |
| CAS:150-86-7 | ChemIDplus |
| CAS:7541-49-3 | KEGG COMPOUND |
| Citations |
|---|