EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H4N4O |
| Net Charge | 0 |
| Average Mass | 136.114 |
| Monoisotopic Mass | 136.03851 |
| SMILES | Oc1ncnc2nncc12 |
| InChI | InChI=1S/C5H4N4O/c10-5-3-1-8-9-4(3)6-2-7-5/h1-2H,(H2,6,7,8,9,10) |
| InChIKey | OFCNXPDARWKPPY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | EC 1.17.3.2 (xanthine oxidase) inhibitor An EC 1.17.3.* (oxidoreductase acting on CH or CH2 with oxygen as acceptor) inhibitor that interferes with the action of xanthine oxidase (EC 1.17.3.2). antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. |
| Application: | gout suppressant A drug that increases uric acid excretion by the kidney (uricosuric drug), decreases uric acid production (antihyperuricemic), or alleviates the pain and inflammation of acute attacks of gout. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| allopurinol (CHEBI:40279) has parent hydride 1H-pyrazolo[4,3-d]pyrimidine (CHEBI:50092) |
| allopurinol (CHEBI:40279) has role antimetabolite (CHEBI:35221) |
| allopurinol (CHEBI:40279) has role EC 1.17.3.2 (xanthine oxidase) inhibitor (CHEBI:35634) |
| allopurinol (CHEBI:40279) has role gout suppressant (CHEBI:35845) |
| allopurinol (CHEBI:40279) has role radical scavenger (CHEBI:48578) |
| allopurinol (CHEBI:40279) is a nucleobase analogue (CHEBI:67142) |
| allopurinol (CHEBI:40279) is a organic heterobicyclic compound (CHEBI:27171) |
| Incoming Relation(s) |
| allopurinol riboside (CHEBI:74074) has functional parent allopurinol (CHEBI:40279) |
| IUPAC Name |
|---|
| 1H-pyrazolo[3,4-d]pyrimidin-4-ol |
| Synonyms | Source |
|---|---|
| 1,5-Dihydro-4H-pyrazolo(3,4-d)pyrimidin-4-one | ChemIDplus |
| 1,5-Dihydro-4H-pyrazolo(3,4-d)pyrimidine-4-one | ChemIDplus |
| 1H-Pyrazolo(3,4-d)pyrimidin-4-ol | ChemIDplus |
| 4-HPP | NIST Chemistry WebBook |
| 4H-Pyrazolo(3,4-d)pyrimidin-4-one | ChemIDplus |
| 4-Hydroxy-1H-pyrazolo(3,4-d)pyrimidine | ChemIDplus |
| Citations |
|---|