EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:30851 - keto-phenylpyruvic acid
| Formula | C9H8O3 |
| Net Charge | 0 |
| Average Mass | 164.160 |
| Monoisotopic Mass | 164.04734 |
| SMILES | O=C(O)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C9H8O3/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5H,6H2,(H,11,12) |
| InChIKey | BTNMPGBKDVTSJY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 6.4.1.1 (pyruvate carboxylase) inhibitor An EC 6.4.1.* (carboxylase) inhibitor that interferes with the action of pyruvate carboxylase (EC 6.4.1.1). fundamental metabolite Any metabolite produced by all living cells. |
| Application: | chromogenic compound Colourless, endogenous or exogenous pigment precursors that may be transformed by biological mechanisms into coloured compounds. They are used in biochemical assays and in diagnosis as indicators, particularly in the form of enzyme substrates. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| keto-phenylpyruvic acid (CHEBI:30851) has functional parent pyruvic acid (CHEBI:32816) |
| keto-phenylpyruvic acid (CHEBI:30851) has role chromogenic compound (CHEBI:75050) |
| keto-phenylpyruvic acid (CHEBI:30851) has role EC 6.4.1.1 (pyruvate carboxylase) inhibitor (CHEBI:90318) |
| keto-phenylpyruvic acid (CHEBI:30851) has role fundamental metabolite (CHEBI:78675) |
| keto-phenylpyruvic acid (CHEBI:30851) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| keto-phenylpyruvic acid (CHEBI:30851) is conjugate acid of keto-phenylpyruvate (CHEBI:18005) |
| keto-phenylpyruvic acid (CHEBI:30851) is tautomer of enol-phenylpyruvic acid (CHEBI:32815) |
| Incoming Relation(s) |
| phenylpyruvic acid oxime (CHEBI:131386) has functional parent keto-phenylpyruvic acid (CHEBI:30851) |
| keto-phenylpyruvate (CHEBI:18005) is conjugate base of keto-phenylpyruvic acid (CHEBI:30851) |
| enol-phenylpyruvic acid (CHEBI:32815) is tautomer of keto-phenylpyruvic acid (CHEBI:30851) |
| IUPAC Name |
|---|
| 2-oxo-3-phenylpropanoic acid |
| Synonyms | Source |
|---|---|
| 3-Phenyl-2-oxopropanoate | KEGG COMPOUND |
| 3-phenyl-2-oxopropanoic acid | NIST Chemistry WebBook |
| 3-phenylpyruvic acid | HMDB |
| 3-PHENYLPYRUVIC ACID | PDBeChem |
| alpha-Ketohydrocinnamic acid | KEGG COMPOUND |
| keto-Phenylpyruvate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00000751 | KNApSAcK |
| C00166 | KEGG COMPOUND |
| DB03884 | DrugBank |
| ECMDB00205 | ECMDB |
| HMDB0000205 | HMDB |
| Phenylpyruvic_acid | Wikipedia |
| PPY | PDBeChem |
| YMDB00786 | YMDB |
| Citations |
|---|