EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9NO3 |
| Net Charge | 0 |
| Average Mass | 179.175 |
| Monoisotopic Mass | 179.05824 |
| SMILES | O=C(O)/C(Cc1ccccc1)=N\O |
| InChI | InChI=1S/C9H9NO3/c11-9(12)8(10-13)6-7-4-2-1-3-5-7/h1-5,13H,6H2,(H,11,12)/b10-8- |
| InChIKey | PNTMGOUAICFJQK-NTMALXAHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | PubMed (26839171) | ||
| - | MetaboLights (MTBLS298) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenylpyruvic acid oxime (CHEBI:131386) has functional parent keto-phenylpyruvic acid (CHEBI:30851) |
| phenylpyruvic acid oxime (CHEBI:131386) is a ketoxime (CHEBI:24983) |
| phenylpyruvic acid oxime (CHEBI:131386) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| (2Z)-2-(hydroxyimino)-3-phenylpropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4922755 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5332991 | Reaxys |