EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10O |
| Net Charge | 0 |
| Average Mass | 194.233 |
| Monoisotopic Mass | 194.07316 |
| SMILES | c1ccc2c(c1)-c1ccccc1C1OC21 |
| InChI | InChI=1S/C14H10O/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)14-13(11)15-14/h1-8,13-14H |
| InChIKey | PXPGRGGVENWVBD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9,10-epoxy-9,10-dihydrophenanthrene (CHEBI:25957) is a phenanthrene oxide (CHEBI:25959) |
| Incoming Relation(s) |
| (9R,10S)-9,10-epoxy-9,10-dihydrophenanthrene (CHEBI:27950) is a 9,10-epoxy-9,10-dihydrophenanthrene (CHEBI:25957) |
| IUPAC Name |
|---|
| 1a,9b-dihydrophenanthro[9,10-b]oxirene |
| Synonyms | Source |
|---|---|
| 1a,9b-dihydro-1-oxa-cyclopropaphenanthrene | UM-BBD |
| 9,10-dihydro-9,10-epoxyphenanthrene | ChemIDplus |
| 9,10-epoxy-9,10-dihydro-phenanthrene | UM-BBD |
| 9,10-epoxy-9,10-dihydrophenanthrene | ChemIDplus |
| phenanthrene-9,10-epoxide | NIST Chemistry WebBook |
| phenanthrene 9,10-oxide | ChemIDplus |