EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8N4O12 |
| Net Charge | 0 |
| Average Mass | 316.135 |
| Monoisotopic Mass | 316.01387 |
| SMILES | O=[N+]([O-])OCC(CO[N+](=O)[O-])(CO[N+](=O)[O-])CO[N+](=O)[O-] |
| InChI | InChI=1S/C5H8N4O12/c10-6(11)18-1-5(2-19-7(12)13,3-20-8(14)15)4-21-9(16)17/h1-4H2 |
| InChIKey | TZRXHJWUDPFEEY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | explosive A substance capable of undergoing rapid and highly exothermic decomposition. |
| Application: | vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pentaerythritol tetranitrate (CHEBI:25879) has role explosive (CHEBI:63490) |
| pentaerythritol tetranitrate (CHEBI:25879) has role vasodilator agent (CHEBI:35620) |
| pentaerythritol tetranitrate (CHEBI:25879) is a pentaerythritol nitrate (CHEBI:25878) |
| INNs | Source |
|---|---|
| pentaerithrityli tetranitras | ChemIDplus |
| pentaerithrityl tetranitrate | KEGG DRUG |
| tetranitrate de pentaerithrityle | ChemIDplus |
| tetranitrato de pentaeritritilo | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1,3-dinitrato-2,2-bis(nitratomethyl)propane | ChemIDplus |
| 2,2-bis(hydroxymethyl)-1,3-propanediol tetranitrate | NIST Chemistry WebBook |
| 2,2-bis((nitrooxy)methyl)-1,3-propanediol dinitrate | ChemIDplus |
| 2,2-bis((nitrooxy)methyl)-1,3-propanediol dinitrate ester | ChemIDplus |
| 3-(nitrooxy)-2,2-bis[(nitrooxy)methyl]propyl nitrate | IUPAC |
| corpent | ChemIDplus |
| UniProt Name | Source |
|---|---|
| pentaerythritol tetranitrate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 2087 | DrugCentral |
| D01721 | KEGG DRUG |
| Pentaerythritol_tetranitrate | Wikipedia |