EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8N4O2 |
| Net Charge | 0 |
| Average Mass | 180.167 |
| Monoisotopic Mass | 180.06473 |
| SMILES | Cn1c(=O)nc2ncn(C)c2c1=O |
| InChI | InChI=1S/C7H8N4O2/c1-10-3-8-5-4(10)6(12)11(2)7(13)9-5/h3H,1-2H3,(H,9,13) |
| InChIKey | QUNWUDVFRNGTCO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | MetaboLights (MTBLS90) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,7-dimethylxanthine (CHEBI:25858) has role central nervous system stimulant (CHEBI:35337) |
| 1,7-dimethylxanthine (CHEBI:25858) has role human blood serum metabolite (CHEBI:85234) |
| 1,7-dimethylxanthine (CHEBI:25858) has role human xenobiotic metabolite (CHEBI:76967) |
| 1,7-dimethylxanthine (CHEBI:25858) has role mouse metabolite (CHEBI:75771) |
| 1,7-dimethylxanthine (CHEBI:25858) is a dimethylxanthine (CHEBI:23818) |
| IUPAC Name |
|---|
| 1,7-dimethyl-3,7-dihydro-1H-purine-2,6-dione |
| Synonyms | Source |
|---|---|
| 1,7-Dimethylxanthine | KEGG COMPOUND |
| 3,7-Dihydro-1,7-dimethyl-1H-purine-2,6-dione | ChemIDplus |
| Paraxanthine | KEGG COMPOUND |
| p-Xanthine | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 1,7-dimethylxanthine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 1-7-DIMETHYLXANTHINE | MetaCyc |
| C13747 | KEGG COMPOUND |
| HMDB0001860 | HMDB |
| LSM-20962 | LINCS |
| Paraxanthine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:197907 | Reaxys |
| CAS:611-59-6 | ChemIDplus |
| CAS:611-59-6 | KEGG COMPOUND |
| Citations |
|---|