EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8N4O2 |
| Net Charge | 0 |
| Average Mass | 180.167 |
| Monoisotopic Mass | 180.06473 |
| SMILES | Cn1c(=O)nc2ncn(C)c2c1=O |
| InChI | InChI=1S/C7H8N4O2/c1-10-3-8-5-4(10)6(12)11(2)7(13)9-5/h3H,1-2H3,(H,9,13) |
| InChIKey | QUNWUDVFRNGTCO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | MetaboLights (MTBLS90) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,7-dimethylxanthine (CHEBI:25858) has role central nervous system stimulant (CHEBI:35337) |
| 1,7-dimethylxanthine (CHEBI:25858) has role human blood serum metabolite (CHEBI:85234) |
| 1,7-dimethylxanthine (CHEBI:25858) has role human xenobiotic metabolite (CHEBI:76967) |
| 1,7-dimethylxanthine (CHEBI:25858) has role mouse metabolite (CHEBI:75771) |
| 1,7-dimethylxanthine (CHEBI:25858) is a dimethylxanthine (CHEBI:23818) |
| IUPAC Name |
|---|
| 1,7-dimethyl-3,7-dihydro-1H-purine-2,6-dione |
| Synonyms | Source |
|---|---|
| 1,7-Dimethylxanthine | KEGG COMPOUND |
| Paraxanthine | KEGG COMPOUND |
| p-Xanthine | ChemIDplus |
| 3,7-Dihydro-1,7-dimethyl-1H-purine-2,6-dione | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 1,7-dimethylxanthine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C13747 | KEGG COMPOUND |
| 1-7-DIMETHYLXANTHINE | MetaCyc |
| HMDB0001860 | HMDB |
| Paraxanthine | Wikipedia |
| LSM-20962 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:197907 | Reaxys |
| CAS:611-59-6 | KEGG COMPOUND |
| CAS:611-59-6 | ChemIDplus |
| Citations |
|---|