EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:28241 - papaverine
| Formula | C20H21NO4 |
| Net Charge | 0 |
| Average Mass | 339.391 |
| Monoisotopic Mass | 339.14706 |
| SMILES | COc1ccc(Cc2nccc3cc(OC)c(OC)cc23)cc1OC |
| InChI | InChI=1S/C20H21NO4/c1-22-17-6-5-13(10-18(17)23-2)9-16-15-12-20(25-4)19(24-3)11-14(15)7-8-21-16/h5-8,10-12H,9H2,1-4H3 |
| InChIKey | XQYZDYMELSJDRZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. vasodilator agent A drug used to cause dilation of the blood vessels. antidiarrhoeal drug Any drug found useful in the symptomatic treatment of diarrhoea. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| papaverine (CHEBI:28241) has role antidiarrhoeal drug (CHEBI:55323) |
| papaverine (CHEBI:28241) has role antineoplastic agent (CHEBI:35610) |
| papaverine (CHEBI:28241) has role antispasmodic drug (CHEBI:53784) |
| papaverine (CHEBI:28241) has role vasodilator agent (CHEBI:35620) |
| papaverine (CHEBI:28241) is a benzylisoquinoline alkaloid (CHEBI:22750) |
| papaverine (CHEBI:28241) is a dimethoxybenzene (CHEBI:51681) |
| papaverine (CHEBI:28241) is a isoquinolines (CHEBI:24922) |
| IUPAC Name |
|---|
| 1-(3,4-dimethoxybenzyl)-6,7-dimethoxyisoquinoline |
| Synonyms | Source |
|---|---|
| NSC-136630 | ChEMBL |
| Papaverine | ChEMBL |
| Papaverinum | ChEMBL |
| Citations |
|---|